diff --git a/posts/panel_material_ui_announcement/images/panel-material-ui-components.png b/posts/panel_material_ui_announcement/images/panel-material-ui-components.png
new file mode 100644
index 0000000..55ea872
Binary files /dev/null and b/posts/panel_material_ui_announcement/images/panel-material-ui-components.png differ
diff --git a/posts/panel_material_ui_announcement/index.ipynb b/posts/panel_material_ui_announcement/index.ipynb
new file mode 100644
index 0000000..915e141
--- /dev/null
+++ b/posts/panel_material_ui_announcement/index.ipynb
@@ -0,0 +1,2072 @@
+{
+ "cells": [
+ {
+ "cell_type": "markdown",
+ "id": "10c11462-c5af-4c84-af69-8bb9b8e86924",
+ "metadata": {},
+ "source": [
+ "---\n",
+ "title: \"panel-material-ui Announcement\"\n",
+ "date: \"2025-05-13\"\n",
+ "description: \"Announcing the release of panel-material-ui, a new extension that wraps Material UI components in Panel.\"\n",
+ "author: \"Philipp Rudiger\"\n",
+ "categories: [announcement, panel]\n",
+ "image: \"images/panel-material-ui-components.png\"\n",
+ "---"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 1,
+ "id": "975a7ce3-27ee-48a1-846f-f7e0ca8f1ccd",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/html": [
+ ""
+ ]
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "(function(root) {\n",
+ " function now() {\n",
+ " return new Date();\n",
+ " }\n",
+ "\n",
+ " const force = true;\n",
+ " const py_version = '3.7.3rc2'.replace('rc', '-rc.').replace('.dev', '-dev.');\n",
+ " const reloading = false;\n",
+ " const Bokeh = root.Bokeh;\n",
+ "\n",
+ " // Set a timeout for this load but only if we are not already initializing\n",
+ " if (typeof (root._bokeh_timeout) === \"undefined\" || (force || !root._bokeh_is_initializing)) {\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_failed_load = false;\n",
+ " }\n",
+ "\n",
+ " function run_callbacks() {\n",
+ " try {\n",
+ " root._bokeh_onload_callbacks.forEach(function(callback) {\n",
+ " if (callback != null)\n",
+ " callback();\n",
+ " });\n",
+ " } finally {\n",
+ " delete root._bokeh_onload_callbacks;\n",
+ " }\n",
+ " console.debug(\"Bokeh: all callbacks have finished\");\n",
+ " }\n",
+ "\n",
+ " function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n",
+ " if (css_urls == null) css_urls = [];\n",
+ " if (js_urls == null) js_urls = [];\n",
+ " if (js_modules == null) js_modules = [];\n",
+ " if (js_exports == null) js_exports = {};\n",
+ "\n",
+ " root._bokeh_onload_callbacks.push(callback);\n",
+ "\n",
+ " if (root._bokeh_is_loading > 0) {\n",
+ " // Don't load bokeh if it is still initializing\n",
+ " console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n",
+ " return null;\n",
+ " } else if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n",
+ " // There is nothing to load\n",
+ " run_callbacks();\n",
+ " return null;\n",
+ " }\n",
+ "\n",
+ " function on_load() {\n",
+ " root._bokeh_is_loading--;\n",
+ " if (root._bokeh_is_loading === 0) {\n",
+ " console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n",
+ " run_callbacks()\n",
+ " }\n",
+ " }\n",
+ " window._bokeh_on_load = on_load\n",
+ "\n",
+ " function on_error(e) {\n",
+ " const src_el = e.srcElement\n",
+ " console.error(\"failed to load \" + (src_el.href || src_el.src));\n",
+ " }\n",
+ "\n",
+ " const skip = [];\n",
+ " if (window.requirejs) {\n",
+ " window.requirejs.config({'packages': {}, 'paths': {}, 'shim': {}});\n",
+ " root._bokeh_is_loading = css_urls.length + 0;\n",
+ " } else {\n",
+ " root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n",
+ " }\n",
+ "\n",
+ " const existing_stylesheets = []\n",
+ " const links = document.getElementsByTagName('link')\n",
+ " for (let i = 0; i < links.length; i++) {\n",
+ " const link = links[i]\n",
+ " if (link.href != null) {\n",
+ " existing_stylesheets.push(link.href)\n",
+ " }\n",
+ " }\n",
+ " for (let i = 0; i < css_urls.length; i++) {\n",
+ " const url = css_urls[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (existing_stylesheets.indexOf(escaped) !== -1) {\n",
+ " on_load()\n",
+ " continue;\n",
+ " }\n",
+ " const element = document.createElement(\"link\");\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.rel = \"stylesheet\";\n",
+ " element.type = \"text/css\";\n",
+ " element.href = url;\n",
+ " console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n",
+ " document.body.appendChild(element);\n",
+ " } var existing_scripts = []\n",
+ " const scripts = document.getElementsByTagName('script')\n",
+ " for (let i = 0; i < scripts.length; i++) {\n",
+ " var script = scripts[i]\n",
+ " if (script.src != null) {\n",
+ " existing_scripts.push(script.src)\n",
+ " }\n",
+ " }\n",
+ " for (let i = 0; i < js_urls.length; i++) {\n",
+ " const url = js_urls[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " const element = document.createElement('script');\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.src = url;\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " for (let i = 0; i < js_modules.length; i++) {\n",
+ " const url = js_modules[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " var element = document.createElement('script');\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.src = url;\n",
+ " element.type = \"module\";\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " for (const name in js_exports) {\n",
+ " const url = js_exports[name];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) >= 0 || root[name] != null) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " var element = document.createElement('script');\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.type = \"module\";\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " element.textContent = `\n",
+ " import ${name} from \"${url}\"\n",
+ " window.${name} = ${name}\n",
+ " window._bokeh_on_load()\n",
+ " `\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " if (!js_urls.length && !js_modules.length) {\n",
+ " on_load()\n",
+ " }\n",
+ " };\n",
+ "\n",
+ " function inject_raw_css(css) {\n",
+ " const element = document.createElement(\"style\");\n",
+ " element.appendChild(document.createTextNode(css));\n",
+ " document.body.appendChild(element);\n",
+ " }\n",
+ "\n",
+ " const js_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/reactiveesm/es-module-shims@^1.10.0/dist/es-module-shims.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-gl-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-widgets-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-tables-3.7.3rc2.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/panel.min.js\"];\n",
+ " const js_modules = [];\n",
+ " const js_exports = {};\n",
+ " const css_urls = [];\n",
+ " const inline_js = [ function(Bokeh) {\n",
+ " Bokeh.set_log_level(\"info\");\n",
+ " },\n",
+ "function(Bokeh) {} // ensure no trailing comma for IE\n",
+ " ];\n",
+ "\n",
+ " function run_inline_js() {\n",
+ " if ((root.Bokeh !== undefined) || (force === true)) {\n",
+ " for (let i = 0; i < inline_js.length; i++) {\n",
+ " try {\n",
+ " inline_js[i].call(root, root.Bokeh);\n",
+ " } catch(e) {\n",
+ " if (!reloading) {\n",
+ " throw e;\n",
+ " }\n",
+ " }\n",
+ " }\n",
+ " // Cache old bokeh versions\n",
+ " if (Bokeh != undefined && !reloading) {\n",
+ " var NewBokeh = root.Bokeh;\n",
+ " if (Bokeh.versions === undefined) {\n",
+ " Bokeh.versions = new Map();\n",
+ " }\n",
+ " if (NewBokeh.version !== Bokeh.version) {\n",
+ " Bokeh.versions.set(NewBokeh.version, NewBokeh)\n",
+ " }\n",
+ " root.Bokeh = Bokeh;\n",
+ " }\n",
+ " } else if (Date.now() < root._bokeh_timeout) {\n",
+ " setTimeout(run_inline_js, 100);\n",
+ " } else if (!root._bokeh_failed_load) {\n",
+ " console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n",
+ " root._bokeh_failed_load = true;\n",
+ " }\n",
+ " root._bokeh_is_initializing = false\n",
+ " }\n",
+ "\n",
+ " function load_or_wait() {\n",
+ " // Implement a backoff loop that tries to ensure we do not load multiple\n",
+ " // versions of Bokeh and its dependencies at the same time.\n",
+ " // In recent versions we use the root._bokeh_is_initializing flag\n",
+ " // to determine whether there is an ongoing attempt to initialize\n",
+ " // bokeh, however for backward compatibility we also try to ensure\n",
+ " // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n",
+ " // before older versions are fully initialized.\n",
+ " if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n",
+ " // If the timeout and bokeh was not successfully loaded we reset\n",
+ " // everything and try loading again\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_is_initializing = false;\n",
+ " root._bokeh_onload_callbacks = undefined;\n",
+ " root._bokeh_is_loading = 0\n",
+ " console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n",
+ " load_or_wait();\n",
+ " } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n",
+ " setTimeout(load_or_wait, 100);\n",
+ " } else {\n",
+ " root._bokeh_is_initializing = true\n",
+ " root._bokeh_onload_callbacks = []\n",
+ " const bokeh_loaded = root.Bokeh != null && (root.Bokeh.version === py_version || (root.Bokeh.versions !== undefined && root.Bokeh.versions.has(py_version)));\n",
+ " if (!reloading && !bokeh_loaded) {\n",
+ " if (root.Bokeh) {\n",
+ " root.Bokeh = undefined;\n",
+ " }\n",
+ " console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n",
+ " }\n",
+ " load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n",
+ " console.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n",
+ " run_inline_js();\n",
+ " });\n",
+ " }\n",
+ " }\n",
+ " // Give older versions of the autoload script a head-start to ensure\n",
+ " // they initialize before we start loading newer version.\n",
+ " setTimeout(load_or_wait, 100)\n",
+ "}(window));"
+ ],
+ "application/vnd.holoviews_load.v0+json": "(function(root) {\n function now() {\n return new Date();\n }\n\n const force = true;\n const py_version = '3.7.3rc2'.replace('rc', '-rc.').replace('.dev', '-dev.');\n const reloading = false;\n const Bokeh = root.Bokeh;\n\n // Set a timeout for this load but only if we are not already initializing\n if (typeof (root._bokeh_timeout) === \"undefined\" || (force || !root._bokeh_is_initializing)) {\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_failed_load = false;\n }\n\n function run_callbacks() {\n try {\n root._bokeh_onload_callbacks.forEach(function(callback) {\n if (callback != null)\n callback();\n });\n } finally {\n delete root._bokeh_onload_callbacks;\n }\n console.debug(\"Bokeh: all callbacks have finished\");\n }\n\n function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n if (css_urls == null) css_urls = [];\n if (js_urls == null) js_urls = [];\n if (js_modules == null) js_modules = [];\n if (js_exports == null) js_exports = {};\n\n root._bokeh_onload_callbacks.push(callback);\n\n if (root._bokeh_is_loading > 0) {\n // Don't load bokeh if it is still initializing\n console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n return null;\n } else if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n // There is nothing to load\n run_callbacks();\n return null;\n }\n\n function on_load() {\n root._bokeh_is_loading--;\n if (root._bokeh_is_loading === 0) {\n console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n run_callbacks()\n }\n }\n window._bokeh_on_load = on_load\n\n function on_error(e) {\n const src_el = e.srcElement\n console.error(\"failed to load \" + (src_el.href || src_el.src));\n }\n\n const skip = [];\n if (window.requirejs) {\n window.requirejs.config({'packages': {}, 'paths': {}, 'shim': {}});\n root._bokeh_is_loading = css_urls.length + 0;\n } else {\n root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n }\n\n const existing_stylesheets = []\n const links = document.getElementsByTagName('link')\n for (let i = 0; i < links.length; i++) {\n const link = links[i]\n if (link.href != null) {\n existing_stylesheets.push(link.href)\n }\n }\n for (let i = 0; i < css_urls.length; i++) {\n const url = css_urls[i];\n const escaped = encodeURI(url)\n if (existing_stylesheets.indexOf(escaped) !== -1) {\n on_load()\n continue;\n }\n const element = document.createElement(\"link\");\n element.onload = on_load;\n element.onerror = on_error;\n element.rel = \"stylesheet\";\n element.type = \"text/css\";\n element.href = url;\n console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n document.body.appendChild(element);\n } var existing_scripts = []\n const scripts = document.getElementsByTagName('script')\n for (let i = 0; i < scripts.length; i++) {\n var script = scripts[i]\n if (script.src != null) {\n existing_scripts.push(script.src)\n }\n }\n for (let i = 0; i < js_urls.length; i++) {\n const url = js_urls[i];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n const element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (let i = 0; i < js_modules.length; i++) {\n const url = js_modules[i];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n var element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (const name in js_exports) {\n const url = js_exports[name];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) >= 0 || root[name] != null) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n var element = document.createElement('script');\n element.onerror = on_error;\n element.async = false;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n element.textContent = `\n import ${name} from \"${url}\"\n window.${name} = ${name}\n window._bokeh_on_load()\n `\n document.head.appendChild(element);\n }\n if (!js_urls.length && !js_modules.length) {\n on_load()\n }\n };\n\n function inject_raw_css(css) {\n const element = document.createElement(\"style\");\n element.appendChild(document.createTextNode(css));\n document.body.appendChild(element);\n }\n\n const js_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/reactiveesm/es-module-shims@^1.10.0/dist/es-module-shims.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-gl-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-widgets-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-tables-3.7.3rc2.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/panel.min.js\"];\n const js_modules = [];\n const js_exports = {};\n const css_urls = [];\n const inline_js = [ function(Bokeh) {\n Bokeh.set_log_level(\"info\");\n },\nfunction(Bokeh) {} // ensure no trailing comma for IE\n ];\n\n function run_inline_js() {\n if ((root.Bokeh !== undefined) || (force === true)) {\n for (let i = 0; i < inline_js.length; i++) {\n try {\n inline_js[i].call(root, root.Bokeh);\n } catch(e) {\n if (!reloading) {\n throw e;\n }\n }\n }\n // Cache old bokeh versions\n if (Bokeh != undefined && !reloading) {\n var NewBokeh = root.Bokeh;\n if (Bokeh.versions === undefined) {\n Bokeh.versions = new Map();\n }\n if (NewBokeh.version !== Bokeh.version) {\n Bokeh.versions.set(NewBokeh.version, NewBokeh)\n }\n root.Bokeh = Bokeh;\n }\n } else if (Date.now() < root._bokeh_timeout) {\n setTimeout(run_inline_js, 100);\n } else if (!root._bokeh_failed_load) {\n console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n root._bokeh_failed_load = true;\n }\n root._bokeh_is_initializing = false\n }\n\n function load_or_wait() {\n // Implement a backoff loop that tries to ensure we do not load multiple\n // versions of Bokeh and its dependencies at the same time.\n // In recent versions we use the root._bokeh_is_initializing flag\n // to determine whether there is an ongoing attempt to initialize\n // bokeh, however for backward compatibility we also try to ensure\n // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n // before older versions are fully initialized.\n if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n // If the timeout and bokeh was not successfully loaded we reset\n // everything and try loading again\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_is_initializing = false;\n root._bokeh_onload_callbacks = undefined;\n root._bokeh_is_loading = 0\n console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n load_or_wait();\n } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n setTimeout(load_or_wait, 100);\n } else {\n root._bokeh_is_initializing = true\n root._bokeh_onload_callbacks = []\n const bokeh_loaded = root.Bokeh != null && (root.Bokeh.version === py_version || (root.Bokeh.versions !== undefined && root.Bokeh.versions.has(py_version)));\n if (!reloading && !bokeh_loaded) {\n if (root.Bokeh) {\n root.Bokeh = undefined;\n }\n console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n }\n load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n console.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n run_inline_js();\n });\n }\n }\n // Give older versions of the autoload script a head-start to ensure\n // they initialize before we start loading newer version.\n setTimeout(load_or_wait, 100)\n}(window));"
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "\n",
+ "if ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n",
+ " window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n",
+ "}\n",
+ "\n",
+ "\n",
+ " function JupyterCommManager() {\n",
+ " }\n",
+ "\n",
+ " JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n",
+ " if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n",
+ " var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n",
+ " comm_manager.register_target(comm_id, function(comm) {\n",
+ " comm.on_msg(msg_handler);\n",
+ " });\n",
+ " } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n",
+ " window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n",
+ " comm.onMsg = msg_handler;\n",
+ " });\n",
+ " } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n",
+ " google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n",
+ " var messages = comm.messages[Symbol.asyncIterator]();\n",
+ " function processIteratorResult(result) {\n",
+ " var message = result.value;\n",
+ " console.log(message)\n",
+ " var content = {data: message.data, comm_id};\n",
+ " var buffers = []\n",
+ " for (var buffer of message.buffers || []) {\n",
+ " buffers.push(new DataView(buffer))\n",
+ " }\n",
+ " var metadata = message.metadata || {};\n",
+ " var msg = {content, buffers, metadata}\n",
+ " msg_handler(msg);\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " })\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n",
+ " if (comm_id in window.PyViz.comms) {\n",
+ " return window.PyViz.comms[comm_id];\n",
+ " } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n",
+ " var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n",
+ " var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n",
+ " if (msg_handler) {\n",
+ " comm.on_msg(msg_handler);\n",
+ " }\n",
+ " } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n",
+ " var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n",
+ " comm.open();\n",
+ " if (msg_handler) {\n",
+ " comm.onMsg = msg_handler;\n",
+ " }\n",
+ " } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n",
+ " var comm_promise = google.colab.kernel.comms.open(comm_id)\n",
+ " comm_promise.then((comm) => {\n",
+ " window.PyViz.comms[comm_id] = comm;\n",
+ " if (msg_handler) {\n",
+ " var messages = comm.messages[Symbol.asyncIterator]();\n",
+ " function processIteratorResult(result) {\n",
+ " var message = result.value;\n",
+ " var content = {data: message.data};\n",
+ " var metadata = message.metadata || {comm_id};\n",
+ " var msg = {content, metadata}\n",
+ " msg_handler(msg);\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " })\n",
+ " var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n",
+ " return comm_promise.then((comm) => {\n",
+ " comm.send(data, metadata, buffers, disposeOnDone);\n",
+ " });\n",
+ " };\n",
+ " var comm = {\n",
+ " send: sendClosure\n",
+ " };\n",
+ " }\n",
+ " window.PyViz.comms[comm_id] = comm;\n",
+ " return comm;\n",
+ " }\n",
+ " window.PyViz.comm_manager = new JupyterCommManager();\n",
+ " \n",
+ "\n",
+ "\n",
+ "var JS_MIME_TYPE = 'application/javascript';\n",
+ "var HTML_MIME_TYPE = 'text/html';\n",
+ "var EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\n",
+ "var CLASS_NAME = 'output';\n",
+ "\n",
+ "/**\n",
+ " * Render data to the DOM node\n",
+ " */\n",
+ "function render(props, node) {\n",
+ " var div = document.createElement(\"div\");\n",
+ " var script = document.createElement(\"script\");\n",
+ " node.appendChild(div);\n",
+ " node.appendChild(script);\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle when a new output is added\n",
+ " */\n",
+ "function handle_add_output(event, handle) {\n",
+ " var output_area = handle.output_area;\n",
+ " var output = handle.output;\n",
+ " if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n",
+ " return\n",
+ " }\n",
+ " var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n",
+ " var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n",
+ " if (id !== undefined) {\n",
+ " var nchildren = toinsert.length;\n",
+ " var html_node = toinsert[nchildren-1].children[0];\n",
+ " html_node.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " var scripts = [];\n",
+ " var nodelist = html_node.querySelectorAll(\"script\");\n",
+ " for (var i in nodelist) {\n",
+ " if (nodelist.hasOwnProperty(i)) {\n",
+ " scripts.push(nodelist[i])\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " scripts.forEach( function (oldScript) {\n",
+ " var newScript = document.createElement(\"script\");\n",
+ " var attrs = [];\n",
+ " var nodemap = oldScript.attributes;\n",
+ " for (var j in nodemap) {\n",
+ " if (nodemap.hasOwnProperty(j)) {\n",
+ " attrs.push(nodemap[j])\n",
+ " }\n",
+ " }\n",
+ " attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n",
+ " newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n",
+ " oldScript.parentNode.replaceChild(newScript, oldScript);\n",
+ " });\n",
+ " if (JS_MIME_TYPE in output.data) {\n",
+ " toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n",
+ " }\n",
+ " output_area._hv_plot_id = id;\n",
+ " if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n",
+ " window.PyViz.plot_index[id] = Bokeh.index[id];\n",
+ " } else {\n",
+ " window.PyViz.plot_index[id] = null;\n",
+ " }\n",
+ " } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n",
+ " var bk_div = document.createElement(\"div\");\n",
+ " bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " var script_attrs = bk_div.children[0].attributes;\n",
+ " for (var i = 0; i < script_attrs.length; i++) {\n",
+ " toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n",
+ " }\n",
+ " // store reference to server id on output_area\n",
+ " output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n",
+ " }\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle when an output is cleared or removed\n",
+ " */\n",
+ "function handle_clear_output(event, handle) {\n",
+ " var id = handle.cell.output_area._hv_plot_id;\n",
+ " var server_id = handle.cell.output_area._bokeh_server_id;\n",
+ " if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n",
+ " var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n",
+ " if (server_id !== null) {\n",
+ " comm.send({event_type: 'server_delete', 'id': server_id});\n",
+ " return;\n",
+ " } else if (comm !== null) {\n",
+ " comm.send({event_type: 'delete', 'id': id});\n",
+ " }\n",
+ " delete PyViz.plot_index[id];\n",
+ " if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n",
+ " var doc = window.Bokeh.index[id].model.document\n",
+ " doc.clear();\n",
+ " const i = window.Bokeh.documents.indexOf(doc);\n",
+ " if (i > -1) {\n",
+ " window.Bokeh.documents.splice(i, 1);\n",
+ " }\n",
+ " }\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle kernel restart event\n",
+ " */\n",
+ "function handle_kernel_cleanup(event, handle) {\n",
+ " delete PyViz.comms[\"hv-extension-comm\"];\n",
+ " window.PyViz.plot_index = {}\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle update_display_data messages\n",
+ " */\n",
+ "function handle_update_output(event, handle) {\n",
+ " handle_clear_output(event, {cell: {output_area: handle.output_area}})\n",
+ " handle_add_output(event, handle)\n",
+ "}\n",
+ "\n",
+ "function register_renderer(events, OutputArea) {\n",
+ " function append_mime(data, metadata, element) {\n",
+ " // create a DOM node to render to\n",
+ " var toinsert = this.create_output_subarea(\n",
+ " metadata,\n",
+ " CLASS_NAME,\n",
+ " EXEC_MIME_TYPE\n",
+ " );\n",
+ " this.keyboard_manager.register_events(toinsert);\n",
+ " // Render to node\n",
+ " var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n",
+ " render(props, toinsert[0]);\n",
+ " element.append(toinsert);\n",
+ " return toinsert\n",
+ " }\n",
+ "\n",
+ " events.on('output_added.OutputArea', handle_add_output);\n",
+ " events.on('output_updated.OutputArea', handle_update_output);\n",
+ " events.on('clear_output.CodeCell', handle_clear_output);\n",
+ " events.on('delete.Cell', handle_clear_output);\n",
+ " events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n",
+ "\n",
+ " OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n",
+ " safe: true,\n",
+ " index: 0\n",
+ " });\n",
+ "}\n",
+ "\n",
+ "if (window.Jupyter !== undefined) {\n",
+ " try {\n",
+ " var events = require('base/js/events');\n",
+ " var OutputArea = require('notebook/js/outputarea').OutputArea;\n",
+ " if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n",
+ " register_renderer(events, OutputArea);\n",
+ " }\n",
+ " } catch(err) {\n",
+ " }\n",
+ "}\n"
+ ],
+ "application/vnd.holoviews_load.v0+json": "\nif ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n}\n\n\n function JupyterCommManager() {\n }\n\n JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n comm_manager.register_target(comm_id, function(comm) {\n comm.on_msg(msg_handler);\n });\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n comm.onMsg = msg_handler;\n });\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n console.log(message)\n var content = {data: message.data, comm_id};\n var buffers = []\n for (var buffer of message.buffers || []) {\n buffers.push(new DataView(buffer))\n }\n var metadata = message.metadata || {};\n var msg = {content, buffers, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n })\n }\n }\n\n JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n if (comm_id in window.PyViz.comms) {\n return window.PyViz.comms[comm_id];\n } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n if (msg_handler) {\n comm.on_msg(msg_handler);\n }\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n comm.open();\n if (msg_handler) {\n comm.onMsg = msg_handler;\n }\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n var comm_promise = google.colab.kernel.comms.open(comm_id)\n comm_promise.then((comm) => {\n window.PyViz.comms[comm_id] = comm;\n if (msg_handler) {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n var content = {data: message.data};\n var metadata = message.metadata || {comm_id};\n var msg = {content, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n }\n })\n var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n return comm_promise.then((comm) => {\n comm.send(data, metadata, buffers, disposeOnDone);\n });\n };\n var comm = {\n send: sendClosure\n };\n }\n window.PyViz.comms[comm_id] = comm;\n return comm;\n }\n window.PyViz.comm_manager = new JupyterCommManager();\n \n\n\nvar JS_MIME_TYPE = 'application/javascript';\nvar HTML_MIME_TYPE = 'text/html';\nvar EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\nvar CLASS_NAME = 'output';\n\n/**\n * Render data to the DOM node\n */\nfunction render(props, node) {\n var div = document.createElement(\"div\");\n var script = document.createElement(\"script\");\n node.appendChild(div);\n node.appendChild(script);\n}\n\n/**\n * Handle when a new output is added\n */\nfunction handle_add_output(event, handle) {\n var output_area = handle.output_area;\n var output = handle.output;\n if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n return\n }\n var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n if (id !== undefined) {\n var nchildren = toinsert.length;\n var html_node = toinsert[nchildren-1].children[0];\n html_node.innerHTML = output.data[HTML_MIME_TYPE];\n var scripts = [];\n var nodelist = html_node.querySelectorAll(\"script\");\n for (var i in nodelist) {\n if (nodelist.hasOwnProperty(i)) {\n scripts.push(nodelist[i])\n }\n }\n\n scripts.forEach( function (oldScript) {\n var newScript = document.createElement(\"script\");\n var attrs = [];\n var nodemap = oldScript.attributes;\n for (var j in nodemap) {\n if (nodemap.hasOwnProperty(j)) {\n attrs.push(nodemap[j])\n }\n }\n attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n oldScript.parentNode.replaceChild(newScript, oldScript);\n });\n if (JS_MIME_TYPE in output.data) {\n toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n }\n output_area._hv_plot_id = id;\n if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n window.PyViz.plot_index[id] = Bokeh.index[id];\n } else {\n window.PyViz.plot_index[id] = null;\n }\n } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n var bk_div = document.createElement(\"div\");\n bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n var script_attrs = bk_div.children[0].attributes;\n for (var i = 0; i < script_attrs.length; i++) {\n toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n }\n // store reference to server id on output_area\n output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n }\n}\n\n/**\n * Handle when an output is cleared or removed\n */\nfunction handle_clear_output(event, handle) {\n var id = handle.cell.output_area._hv_plot_id;\n var server_id = handle.cell.output_area._bokeh_server_id;\n if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n if (server_id !== null) {\n comm.send({event_type: 'server_delete', 'id': server_id});\n return;\n } else if (comm !== null) {\n comm.send({event_type: 'delete', 'id': id});\n }\n delete PyViz.plot_index[id];\n if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n var doc = window.Bokeh.index[id].model.document\n doc.clear();\n const i = window.Bokeh.documents.indexOf(doc);\n if (i > -1) {\n window.Bokeh.documents.splice(i, 1);\n }\n }\n}\n\n/**\n * Handle kernel restart event\n */\nfunction handle_kernel_cleanup(event, handle) {\n delete PyViz.comms[\"hv-extension-comm\"];\n window.PyViz.plot_index = {}\n}\n\n/**\n * Handle update_display_data messages\n */\nfunction handle_update_output(event, handle) {\n handle_clear_output(event, {cell: {output_area: handle.output_area}})\n handle_add_output(event, handle)\n}\n\nfunction register_renderer(events, OutputArea) {\n function append_mime(data, metadata, element) {\n // create a DOM node to render to\n var toinsert = this.create_output_subarea(\n metadata,\n CLASS_NAME,\n EXEC_MIME_TYPE\n );\n this.keyboard_manager.register_events(toinsert);\n // Render to node\n var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n render(props, toinsert[0]);\n element.append(toinsert);\n return toinsert\n }\n\n events.on('output_added.OutputArea', handle_add_output);\n events.on('output_updated.OutputArea', handle_update_output);\n events.on('clear_output.CodeCell', handle_clear_output);\n events.on('delete.Cell', handle_clear_output);\n events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n\n OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n safe: true,\n index: 0\n });\n}\n\nif (window.Jupyter !== undefined) {\n try {\n var events = require('base/js/events');\n var OutputArea = require('notebook/js/outputarea').OutputArea;\n if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n register_renderer(events, OutputArea);\n }\n } catch(err) {\n }\n}\n"
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/vnd.holoviews_exec.v0+json": "",
+ "text/html": [
+ "
\n",
+ ""
+ ]
+ },
+ "metadata": {
+ "application/vnd.holoviews_exec.v0+json": {
+ "id": "853f676e-cd1f-402c-a65c-6e14b3921178"
+ }
+ },
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "text/html": [
+ ""
+ ]
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "(function(root) {\n",
+ " function now() {\n",
+ " return new Date();\n",
+ " }\n",
+ "\n",
+ " const force = false;\n",
+ " const py_version = '3.7.3rc2'.replace('rc', '-rc.').replace('.dev', '-dev.');\n",
+ " const reloading = true;\n",
+ " const Bokeh = root.Bokeh;\n",
+ "\n",
+ " // Set a timeout for this load but only if we are not already initializing\n",
+ " if (typeof (root._bokeh_timeout) === \"undefined\" || (force || !root._bokeh_is_initializing)) {\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_failed_load = false;\n",
+ " }\n",
+ "\n",
+ " function run_callbacks() {\n",
+ " try {\n",
+ " root._bokeh_onload_callbacks.forEach(function(callback) {\n",
+ " if (callback != null)\n",
+ " callback();\n",
+ " });\n",
+ " } finally {\n",
+ " delete root._bokeh_onload_callbacks;\n",
+ " }\n",
+ " console.debug(\"Bokeh: all callbacks have finished\");\n",
+ " }\n",
+ "\n",
+ " function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n",
+ " if (css_urls == null) css_urls = [];\n",
+ " if (js_urls == null) js_urls = [];\n",
+ " if (js_modules == null) js_modules = [];\n",
+ " if (js_exports == null) js_exports = {};\n",
+ "\n",
+ " root._bokeh_onload_callbacks.push(callback);\n",
+ "\n",
+ " if (root._bokeh_is_loading > 0) {\n",
+ " // Don't load bokeh if it is still initializing\n",
+ " console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n",
+ " return null;\n",
+ " } else if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n",
+ " // There is nothing to load\n",
+ " run_callbacks();\n",
+ " return null;\n",
+ " }\n",
+ "\n",
+ " function on_load() {\n",
+ " root._bokeh_is_loading--;\n",
+ " if (root._bokeh_is_loading === 0) {\n",
+ " console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n",
+ " run_callbacks()\n",
+ " }\n",
+ " }\n",
+ " window._bokeh_on_load = on_load\n",
+ "\n",
+ " function on_error(e) {\n",
+ " const src_el = e.srcElement\n",
+ " console.error(\"failed to load \" + (src_el.href || src_el.src));\n",
+ " }\n",
+ "\n",
+ " const skip = [];\n",
+ " if (window.requirejs) {\n",
+ " window.requirejs.config({'packages': {}, 'paths': {'tabulator': 'https://cdn.jsdelivr.net/npm/tabulator-tables@6.3.1/dist/js/tabulator.min', 'moment': 'https://cdn.jsdelivr.net/npm/luxon/build/global/luxon.min'}, 'shim': {}});\n",
+ " require([\"tabulator\"], function(Tabulator) {\n",
+ " window.Tabulator = Tabulator\n",
+ " on_load()\n",
+ " })\n",
+ " require([\"moment\"], function(moment) {\n",
+ " window.moment = moment\n",
+ " on_load()\n",
+ " })\n",
+ " root._bokeh_is_loading = css_urls.length + 2;\n",
+ " } else {\n",
+ " root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n",
+ " }\n",
+ "\n",
+ " const existing_stylesheets = []\n",
+ " const links = document.getElementsByTagName('link')\n",
+ " for (let i = 0; i < links.length; i++) {\n",
+ " const link = links[i]\n",
+ " if (link.href != null) {\n",
+ " existing_stylesheets.push(link.href)\n",
+ " }\n",
+ " }\n",
+ " for (let i = 0; i < css_urls.length; i++) {\n",
+ " const url = css_urls[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (existing_stylesheets.indexOf(escaped) !== -1) {\n",
+ " on_load()\n",
+ " continue;\n",
+ " }\n",
+ " const element = document.createElement(\"link\");\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.rel = \"stylesheet\";\n",
+ " element.type = \"text/css\";\n",
+ " element.href = url;\n",
+ " console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n",
+ " document.body.appendChild(element);\n",
+ " } if (((window.Tabulator !== undefined) && (!(window.Tabulator instanceof HTMLElement))) || window.requirejs) {\n",
+ " var urls = ['https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/js/tabulator.min.js'];\n",
+ " for (var i = 0; i < urls.length; i++) {\n",
+ " skip.push(encodeURI(urls[i]))\n",
+ " }\n",
+ " } if (((window.moment !== undefined) && (!(window.moment instanceof HTMLElement))) || window.requirejs) {\n",
+ " var urls = ['https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/luxon/build/global/luxon.min.js'];\n",
+ " for (var i = 0; i < urls.length; i++) {\n",
+ " skip.push(encodeURI(urls[i]))\n",
+ " }\n",
+ " } var existing_scripts = []\n",
+ " const scripts = document.getElementsByTagName('script')\n",
+ " for (let i = 0; i < scripts.length; i++) {\n",
+ " var script = scripts[i]\n",
+ " if (script.src != null) {\n",
+ " existing_scripts.push(script.src)\n",
+ " }\n",
+ " }\n",
+ " for (let i = 0; i < js_urls.length; i++) {\n",
+ " const url = js_urls[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " const element = document.createElement('script');\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.src = url;\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " for (let i = 0; i < js_modules.length; i++) {\n",
+ " const url = js_modules[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " var element = document.createElement('script');\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.src = url;\n",
+ " element.type = \"module\";\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " for (const name in js_exports) {\n",
+ " const url = js_exports[name];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) >= 0 || root[name] != null) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " var element = document.createElement('script');\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.type = \"module\";\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " element.textContent = `\n",
+ " import ${name} from \"${url}\"\n",
+ " window.${name} = ${name}\n",
+ " window._bokeh_on_load()\n",
+ " `\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " if (!js_urls.length && !js_modules.length) {\n",
+ " on_load()\n",
+ " }\n",
+ " };\n",
+ "\n",
+ " function inject_raw_css(css) {\n",
+ " const element = document.createElement(\"style\");\n",
+ " element.appendChild(document.createTextNode(css));\n",
+ " document.body.appendChild(element);\n",
+ " }\n",
+ "\n",
+ " const js_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/reactiveesm/es-module-shims@^1.10.0/dist/es-module-shims.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/js/tabulator.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/luxon/build/global/luxon.min.js\"];\n",
+ " const js_modules = [];\n",
+ " const js_exports = {};\n",
+ " const css_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/css/tabulator_simple.min.css?v=1.7.0\", \"https://cdn.holoviz.org/panel-material-ui/v0.1.0/panel-material-ui.bundle.css?v=1.7.0\"];\n",
+ " const inline_js = [ function(Bokeh) {\n",
+ " Bokeh.set_log_level(\"info\");\n",
+ " },\n",
+ "function(Bokeh) {} // ensure no trailing comma for IE\n",
+ " ];\n",
+ "\n",
+ " function run_inline_js() {\n",
+ " if ((root.Bokeh !== undefined) || (force === true)) {\n",
+ " for (let i = 0; i < inline_js.length; i++) {\n",
+ " try {\n",
+ " inline_js[i].call(root, root.Bokeh);\n",
+ " } catch(e) {\n",
+ " if (!reloading) {\n",
+ " throw e;\n",
+ " }\n",
+ " }\n",
+ " }\n",
+ " // Cache old bokeh versions\n",
+ " if (Bokeh != undefined && !reloading) {\n",
+ " var NewBokeh = root.Bokeh;\n",
+ " if (Bokeh.versions === undefined) {\n",
+ " Bokeh.versions = new Map();\n",
+ " }\n",
+ " if (NewBokeh.version !== Bokeh.version) {\n",
+ " Bokeh.versions.set(NewBokeh.version, NewBokeh)\n",
+ " }\n",
+ " root.Bokeh = Bokeh;\n",
+ " }\n",
+ " } else if (Date.now() < root._bokeh_timeout) {\n",
+ " setTimeout(run_inline_js, 100);\n",
+ " } else if (!root._bokeh_failed_load) {\n",
+ " console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n",
+ " root._bokeh_failed_load = true;\n",
+ " }\n",
+ " root._bokeh_is_initializing = false\n",
+ " }\n",
+ "\n",
+ " function load_or_wait() {\n",
+ " // Implement a backoff loop that tries to ensure we do not load multiple\n",
+ " // versions of Bokeh and its dependencies at the same time.\n",
+ " // In recent versions we use the root._bokeh_is_initializing flag\n",
+ " // to determine whether there is an ongoing attempt to initialize\n",
+ " // bokeh, however for backward compatibility we also try to ensure\n",
+ " // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n",
+ " // before older versions are fully initialized.\n",
+ " if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n",
+ " // If the timeout and bokeh was not successfully loaded we reset\n",
+ " // everything and try loading again\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_is_initializing = false;\n",
+ " root._bokeh_onload_callbacks = undefined;\n",
+ " root._bokeh_is_loading = 0\n",
+ " console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n",
+ " load_or_wait();\n",
+ " } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n",
+ " setTimeout(load_or_wait, 100);\n",
+ " } else {\n",
+ " root._bokeh_is_initializing = true\n",
+ " root._bokeh_onload_callbacks = []\n",
+ " const bokeh_loaded = root.Bokeh != null && (root.Bokeh.version === py_version || (root.Bokeh.versions !== undefined && root.Bokeh.versions.has(py_version)));\n",
+ " if (!reloading && !bokeh_loaded) {\n",
+ " if (root.Bokeh) {\n",
+ " root.Bokeh = undefined;\n",
+ " }\n",
+ " console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n",
+ " }\n",
+ " load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n",
+ " console.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n",
+ " run_inline_js();\n",
+ " });\n",
+ " }\n",
+ " }\n",
+ " // Give older versions of the autoload script a head-start to ensure\n",
+ " // they initialize before we start loading newer version.\n",
+ " setTimeout(load_or_wait, 100)\n",
+ "}(window));"
+ ],
+ "application/vnd.holoviews_load.v0+json": "(function(root) {\n function now() {\n return new Date();\n }\n\n const force = false;\n const py_version = '3.7.3rc2'.replace('rc', '-rc.').replace('.dev', '-dev.');\n const reloading = true;\n const Bokeh = root.Bokeh;\n\n // Set a timeout for this load but only if we are not already initializing\n if (typeof (root._bokeh_timeout) === \"undefined\" || (force || !root._bokeh_is_initializing)) {\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_failed_load = false;\n }\n\n function run_callbacks() {\n try {\n root._bokeh_onload_callbacks.forEach(function(callback) {\n if (callback != null)\n callback();\n });\n } finally {\n delete root._bokeh_onload_callbacks;\n }\n console.debug(\"Bokeh: all callbacks have finished\");\n }\n\n function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n if (css_urls == null) css_urls = [];\n if (js_urls == null) js_urls = [];\n if (js_modules == null) js_modules = [];\n if (js_exports == null) js_exports = {};\n\n root._bokeh_onload_callbacks.push(callback);\n\n if (root._bokeh_is_loading > 0) {\n // Don't load bokeh if it is still initializing\n console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n return null;\n } else if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n // There is nothing to load\n run_callbacks();\n return null;\n }\n\n function on_load() {\n root._bokeh_is_loading--;\n if (root._bokeh_is_loading === 0) {\n console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n run_callbacks()\n }\n }\n window._bokeh_on_load = on_load\n\n function on_error(e) {\n const src_el = e.srcElement\n console.error(\"failed to load \" + (src_el.href || src_el.src));\n }\n\n const skip = [];\n if (window.requirejs) {\n window.requirejs.config({'packages': {}, 'paths': {'tabulator': 'https://cdn.jsdelivr.net/npm/tabulator-tables@6.3.1/dist/js/tabulator.min', 'moment': 'https://cdn.jsdelivr.net/npm/luxon/build/global/luxon.min'}, 'shim': {}});\n require([\"tabulator\"], function(Tabulator) {\n window.Tabulator = Tabulator\n on_load()\n })\n require([\"moment\"], function(moment) {\n window.moment = moment\n on_load()\n })\n root._bokeh_is_loading = css_urls.length + 2;\n } else {\n root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n }\n\n const existing_stylesheets = []\n const links = document.getElementsByTagName('link')\n for (let i = 0; i < links.length; i++) {\n const link = links[i]\n if (link.href != null) {\n existing_stylesheets.push(link.href)\n }\n }\n for (let i = 0; i < css_urls.length; i++) {\n const url = css_urls[i];\n const escaped = encodeURI(url)\n if (existing_stylesheets.indexOf(escaped) !== -1) {\n on_load()\n continue;\n }\n const element = document.createElement(\"link\");\n element.onload = on_load;\n element.onerror = on_error;\n element.rel = \"stylesheet\";\n element.type = \"text/css\";\n element.href = url;\n console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n document.body.appendChild(element);\n } if (((window.Tabulator !== undefined) && (!(window.Tabulator instanceof HTMLElement))) || window.requirejs) {\n var urls = ['https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/js/tabulator.min.js'];\n for (var i = 0; i < urls.length; i++) {\n skip.push(encodeURI(urls[i]))\n }\n } if (((window.moment !== undefined) && (!(window.moment instanceof HTMLElement))) || window.requirejs) {\n var urls = ['https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/luxon/build/global/luxon.min.js'];\n for (var i = 0; i < urls.length; i++) {\n skip.push(encodeURI(urls[i]))\n }\n } var existing_scripts = []\n const scripts = document.getElementsByTagName('script')\n for (let i = 0; i < scripts.length; i++) {\n var script = scripts[i]\n if (script.src != null) {\n existing_scripts.push(script.src)\n }\n }\n for (let i = 0; i < js_urls.length; i++) {\n const url = js_urls[i];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n const element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (let i = 0; i < js_modules.length; i++) {\n const url = js_modules[i];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n var element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (const name in js_exports) {\n const url = js_exports[name];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) >= 0 || root[name] != null) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n var element = document.createElement('script');\n element.onerror = on_error;\n element.async = false;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n element.textContent = `\n import ${name} from \"${url}\"\n window.${name} = ${name}\n window._bokeh_on_load()\n `\n document.head.appendChild(element);\n }\n if (!js_urls.length && !js_modules.length) {\n on_load()\n }\n };\n\n function inject_raw_css(css) {\n const element = document.createElement(\"style\");\n element.appendChild(document.createTextNode(css));\n document.body.appendChild(element);\n }\n\n const js_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/reactiveesm/es-module-shims@^1.10.0/dist/es-module-shims.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/js/tabulator.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/luxon/build/global/luxon.min.js\"];\n const js_modules = [];\n const js_exports = {};\n const css_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/css/tabulator_simple.min.css?v=1.7.0\", \"https://cdn.holoviz.org/panel-material-ui/v0.1.0/panel-material-ui.bundle.css?v=1.7.0\"];\n const inline_js = [ function(Bokeh) {\n Bokeh.set_log_level(\"info\");\n },\nfunction(Bokeh) {} // ensure no trailing comma for IE\n ];\n\n function run_inline_js() {\n if ((root.Bokeh !== undefined) || (force === true)) {\n for (let i = 0; i < inline_js.length; i++) {\n try {\n inline_js[i].call(root, root.Bokeh);\n } catch(e) {\n if (!reloading) {\n throw e;\n }\n }\n }\n // Cache old bokeh versions\n if (Bokeh != undefined && !reloading) {\n var NewBokeh = root.Bokeh;\n if (Bokeh.versions === undefined) {\n Bokeh.versions = new Map();\n }\n if (NewBokeh.version !== Bokeh.version) {\n Bokeh.versions.set(NewBokeh.version, NewBokeh)\n }\n root.Bokeh = Bokeh;\n }\n } else if (Date.now() < root._bokeh_timeout) {\n setTimeout(run_inline_js, 100);\n } else if (!root._bokeh_failed_load) {\n console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n root._bokeh_failed_load = true;\n }\n root._bokeh_is_initializing = false\n }\n\n function load_or_wait() {\n // Implement a backoff loop that tries to ensure we do not load multiple\n // versions of Bokeh and its dependencies at the same time.\n // In recent versions we use the root._bokeh_is_initializing flag\n // to determine whether there is an ongoing attempt to initialize\n // bokeh, however for backward compatibility we also try to ensure\n // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n // before older versions are fully initialized.\n if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n // If the timeout and bokeh was not successfully loaded we reset\n // everything and try loading again\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_is_initializing = false;\n root._bokeh_onload_callbacks = undefined;\n root._bokeh_is_loading = 0\n console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n load_or_wait();\n } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n setTimeout(load_or_wait, 100);\n } else {\n root._bokeh_is_initializing = true\n root._bokeh_onload_callbacks = []\n const bokeh_loaded = root.Bokeh != null && (root.Bokeh.version === py_version || (root.Bokeh.versions !== undefined && root.Bokeh.versions.has(py_version)));\n if (!reloading && !bokeh_loaded) {\n if (root.Bokeh) {\n root.Bokeh = undefined;\n }\n console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n }\n load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n console.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n run_inline_js();\n });\n }\n }\n // Give older versions of the autoload script a head-start to ensure\n // they initialize before we start loading newer version.\n setTimeout(load_or_wait, 100)\n}(window));"
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "\n",
+ "if ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n",
+ " window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n",
+ "}\n",
+ "\n",
+ "\n",
+ " function JupyterCommManager() {\n",
+ " }\n",
+ "\n",
+ " JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n",
+ " if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n",
+ " var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n",
+ " comm_manager.register_target(comm_id, function(comm) {\n",
+ " comm.on_msg(msg_handler);\n",
+ " });\n",
+ " } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n",
+ " window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n",
+ " comm.onMsg = msg_handler;\n",
+ " });\n",
+ " } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n",
+ " google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n",
+ " var messages = comm.messages[Symbol.asyncIterator]();\n",
+ " function processIteratorResult(result) {\n",
+ " var message = result.value;\n",
+ " console.log(message)\n",
+ " var content = {data: message.data, comm_id};\n",
+ " var buffers = []\n",
+ " for (var buffer of message.buffers || []) {\n",
+ " buffers.push(new DataView(buffer))\n",
+ " }\n",
+ " var metadata = message.metadata || {};\n",
+ " var msg = {content, buffers, metadata}\n",
+ " msg_handler(msg);\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " })\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n",
+ " if (comm_id in window.PyViz.comms) {\n",
+ " return window.PyViz.comms[comm_id];\n",
+ " } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n",
+ " var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n",
+ " var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n",
+ " if (msg_handler) {\n",
+ " comm.on_msg(msg_handler);\n",
+ " }\n",
+ " } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n",
+ " var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n",
+ " comm.open();\n",
+ " if (msg_handler) {\n",
+ " comm.onMsg = msg_handler;\n",
+ " }\n",
+ " } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n",
+ " var comm_promise = google.colab.kernel.comms.open(comm_id)\n",
+ " comm_promise.then((comm) => {\n",
+ " window.PyViz.comms[comm_id] = comm;\n",
+ " if (msg_handler) {\n",
+ " var messages = comm.messages[Symbol.asyncIterator]();\n",
+ " function processIteratorResult(result) {\n",
+ " var message = result.value;\n",
+ " var content = {data: message.data};\n",
+ " var metadata = message.metadata || {comm_id};\n",
+ " var msg = {content, metadata}\n",
+ " msg_handler(msg);\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " })\n",
+ " var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n",
+ " return comm_promise.then((comm) => {\n",
+ " comm.send(data, metadata, buffers, disposeOnDone);\n",
+ " });\n",
+ " };\n",
+ " var comm = {\n",
+ " send: sendClosure\n",
+ " };\n",
+ " }\n",
+ " window.PyViz.comms[comm_id] = comm;\n",
+ " return comm;\n",
+ " }\n",
+ " window.PyViz.comm_manager = new JupyterCommManager();\n",
+ " \n",
+ "\n",
+ "\n",
+ "var JS_MIME_TYPE = 'application/javascript';\n",
+ "var HTML_MIME_TYPE = 'text/html';\n",
+ "var EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\n",
+ "var CLASS_NAME = 'output';\n",
+ "\n",
+ "/**\n",
+ " * Render data to the DOM node\n",
+ " */\n",
+ "function render(props, node) {\n",
+ " var div = document.createElement(\"div\");\n",
+ " var script = document.createElement(\"script\");\n",
+ " node.appendChild(div);\n",
+ " node.appendChild(script);\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle when a new output is added\n",
+ " */\n",
+ "function handle_add_output(event, handle) {\n",
+ " var output_area = handle.output_area;\n",
+ " var output = handle.output;\n",
+ " if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n",
+ " return\n",
+ " }\n",
+ " var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n",
+ " var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n",
+ " if (id !== undefined) {\n",
+ " var nchildren = toinsert.length;\n",
+ " var html_node = toinsert[nchildren-1].children[0];\n",
+ " html_node.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " var scripts = [];\n",
+ " var nodelist = html_node.querySelectorAll(\"script\");\n",
+ " for (var i in nodelist) {\n",
+ " if (nodelist.hasOwnProperty(i)) {\n",
+ " scripts.push(nodelist[i])\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " scripts.forEach( function (oldScript) {\n",
+ " var newScript = document.createElement(\"script\");\n",
+ " var attrs = [];\n",
+ " var nodemap = oldScript.attributes;\n",
+ " for (var j in nodemap) {\n",
+ " if (nodemap.hasOwnProperty(j)) {\n",
+ " attrs.push(nodemap[j])\n",
+ " }\n",
+ " }\n",
+ " attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n",
+ " newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n",
+ " oldScript.parentNode.replaceChild(newScript, oldScript);\n",
+ " });\n",
+ " if (JS_MIME_TYPE in output.data) {\n",
+ " toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n",
+ " }\n",
+ " output_area._hv_plot_id = id;\n",
+ " if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n",
+ " window.PyViz.plot_index[id] = Bokeh.index[id];\n",
+ " } else {\n",
+ " window.PyViz.plot_index[id] = null;\n",
+ " }\n",
+ " } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n",
+ " var bk_div = document.createElement(\"div\");\n",
+ " bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " var script_attrs = bk_div.children[0].attributes;\n",
+ " for (var i = 0; i < script_attrs.length; i++) {\n",
+ " toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n",
+ " }\n",
+ " // store reference to server id on output_area\n",
+ " output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n",
+ " }\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle when an output is cleared or removed\n",
+ " */\n",
+ "function handle_clear_output(event, handle) {\n",
+ " var id = handle.cell.output_area._hv_plot_id;\n",
+ " var server_id = handle.cell.output_area._bokeh_server_id;\n",
+ " if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n",
+ " var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n",
+ " if (server_id !== null) {\n",
+ " comm.send({event_type: 'server_delete', 'id': server_id});\n",
+ " return;\n",
+ " } else if (comm !== null) {\n",
+ " comm.send({event_type: 'delete', 'id': id});\n",
+ " }\n",
+ " delete PyViz.plot_index[id];\n",
+ " if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n",
+ " var doc = window.Bokeh.index[id].model.document\n",
+ " doc.clear();\n",
+ " const i = window.Bokeh.documents.indexOf(doc);\n",
+ " if (i > -1) {\n",
+ " window.Bokeh.documents.splice(i, 1);\n",
+ " }\n",
+ " }\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle kernel restart event\n",
+ " */\n",
+ "function handle_kernel_cleanup(event, handle) {\n",
+ " delete PyViz.comms[\"hv-extension-comm\"];\n",
+ " window.PyViz.plot_index = {}\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle update_display_data messages\n",
+ " */\n",
+ "function handle_update_output(event, handle) {\n",
+ " handle_clear_output(event, {cell: {output_area: handle.output_area}})\n",
+ " handle_add_output(event, handle)\n",
+ "}\n",
+ "\n",
+ "function register_renderer(events, OutputArea) {\n",
+ " function append_mime(data, metadata, element) {\n",
+ " // create a DOM node to render to\n",
+ " var toinsert = this.create_output_subarea(\n",
+ " metadata,\n",
+ " CLASS_NAME,\n",
+ " EXEC_MIME_TYPE\n",
+ " );\n",
+ " this.keyboard_manager.register_events(toinsert);\n",
+ " // Render to node\n",
+ " var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n",
+ " render(props, toinsert[0]);\n",
+ " element.append(toinsert);\n",
+ " return toinsert\n",
+ " }\n",
+ "\n",
+ " events.on('output_added.OutputArea', handle_add_output);\n",
+ " events.on('output_updated.OutputArea', handle_update_output);\n",
+ " events.on('clear_output.CodeCell', handle_clear_output);\n",
+ " events.on('delete.Cell', handle_clear_output);\n",
+ " events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n",
+ "\n",
+ " OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n",
+ " safe: true,\n",
+ " index: 0\n",
+ " });\n",
+ "}\n",
+ "\n",
+ "if (window.Jupyter !== undefined) {\n",
+ " try {\n",
+ " var events = require('base/js/events');\n",
+ " var OutputArea = require('notebook/js/outputarea').OutputArea;\n",
+ " if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n",
+ " register_renderer(events, OutputArea);\n",
+ " }\n",
+ " } catch(err) {\n",
+ " }\n",
+ "}\n"
+ ],
+ "application/vnd.holoviews_load.v0+json": "\nif ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n}\n\n\n function JupyterCommManager() {\n }\n\n JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n comm_manager.register_target(comm_id, function(comm) {\n comm.on_msg(msg_handler);\n });\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n comm.onMsg = msg_handler;\n });\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n console.log(message)\n var content = {data: message.data, comm_id};\n var buffers = []\n for (var buffer of message.buffers || []) {\n buffers.push(new DataView(buffer))\n }\n var metadata = message.metadata || {};\n var msg = {content, buffers, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n })\n }\n }\n\n JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n if (comm_id in window.PyViz.comms) {\n return window.PyViz.comms[comm_id];\n } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n if (msg_handler) {\n comm.on_msg(msg_handler);\n }\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n comm.open();\n if (msg_handler) {\n comm.onMsg = msg_handler;\n }\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n var comm_promise = google.colab.kernel.comms.open(comm_id)\n comm_promise.then((comm) => {\n window.PyViz.comms[comm_id] = comm;\n if (msg_handler) {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n var content = {data: message.data};\n var metadata = message.metadata || {comm_id};\n var msg = {content, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n }\n })\n var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n return comm_promise.then((comm) => {\n comm.send(data, metadata, buffers, disposeOnDone);\n });\n };\n var comm = {\n send: sendClosure\n };\n }\n window.PyViz.comms[comm_id] = comm;\n return comm;\n }\n window.PyViz.comm_manager = new JupyterCommManager();\n \n\n\nvar JS_MIME_TYPE = 'application/javascript';\nvar HTML_MIME_TYPE = 'text/html';\nvar EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\nvar CLASS_NAME = 'output';\n\n/**\n * Render data to the DOM node\n */\nfunction render(props, node) {\n var div = document.createElement(\"div\");\n var script = document.createElement(\"script\");\n node.appendChild(div);\n node.appendChild(script);\n}\n\n/**\n * Handle when a new output is added\n */\nfunction handle_add_output(event, handle) {\n var output_area = handle.output_area;\n var output = handle.output;\n if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n return\n }\n var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n if (id !== undefined) {\n var nchildren = toinsert.length;\n var html_node = toinsert[nchildren-1].children[0];\n html_node.innerHTML = output.data[HTML_MIME_TYPE];\n var scripts = [];\n var nodelist = html_node.querySelectorAll(\"script\");\n for (var i in nodelist) {\n if (nodelist.hasOwnProperty(i)) {\n scripts.push(nodelist[i])\n }\n }\n\n scripts.forEach( function (oldScript) {\n var newScript = document.createElement(\"script\");\n var attrs = [];\n var nodemap = oldScript.attributes;\n for (var j in nodemap) {\n if (nodemap.hasOwnProperty(j)) {\n attrs.push(nodemap[j])\n }\n }\n attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n oldScript.parentNode.replaceChild(newScript, oldScript);\n });\n if (JS_MIME_TYPE in output.data) {\n toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n }\n output_area._hv_plot_id = id;\n if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n window.PyViz.plot_index[id] = Bokeh.index[id];\n } else {\n window.PyViz.plot_index[id] = null;\n }\n } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n var bk_div = document.createElement(\"div\");\n bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n var script_attrs = bk_div.children[0].attributes;\n for (var i = 0; i < script_attrs.length; i++) {\n toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n }\n // store reference to server id on output_area\n output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n }\n}\n\n/**\n * Handle when an output is cleared or removed\n */\nfunction handle_clear_output(event, handle) {\n var id = handle.cell.output_area._hv_plot_id;\n var server_id = handle.cell.output_area._bokeh_server_id;\n if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n if (server_id !== null) {\n comm.send({event_type: 'server_delete', 'id': server_id});\n return;\n } else if (comm !== null) {\n comm.send({event_type: 'delete', 'id': id});\n }\n delete PyViz.plot_index[id];\n if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n var doc = window.Bokeh.index[id].model.document\n doc.clear();\n const i = window.Bokeh.documents.indexOf(doc);\n if (i > -1) {\n window.Bokeh.documents.splice(i, 1);\n }\n }\n}\n\n/**\n * Handle kernel restart event\n */\nfunction handle_kernel_cleanup(event, handle) {\n delete PyViz.comms[\"hv-extension-comm\"];\n window.PyViz.plot_index = {}\n}\n\n/**\n * Handle update_display_data messages\n */\nfunction handle_update_output(event, handle) {\n handle_clear_output(event, {cell: {output_area: handle.output_area}})\n handle_add_output(event, handle)\n}\n\nfunction register_renderer(events, OutputArea) {\n function append_mime(data, metadata, element) {\n // create a DOM node to render to\n var toinsert = this.create_output_subarea(\n metadata,\n CLASS_NAME,\n EXEC_MIME_TYPE\n );\n this.keyboard_manager.register_events(toinsert);\n // Render to node\n var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n render(props, toinsert[0]);\n element.append(toinsert);\n return toinsert\n }\n\n events.on('output_added.OutputArea', handle_add_output);\n events.on('output_updated.OutputArea', handle_update_output);\n events.on('clear_output.CodeCell', handle_clear_output);\n events.on('delete.Cell', handle_clear_output);\n events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n\n OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n safe: true,\n index: 0\n });\n}\n\nif (window.Jupyter !== undefined) {\n try {\n var events = require('base/js/events');\n var OutputArea = require('notebook/js/outputarea').OutputArea;\n if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n register_renderer(events, OutputArea);\n }\n } catch(err) {\n }\n}\n"
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ }
+ ],
+ "source": [
+ "#| echo: false\n",
+ "import hvplot.pandas\n",
+ "import panel as pn\n",
+ "import pandas as pd\n",
+ "import panel_material_ui as pmui\n",
+ "\n",
+ "df = pd.read_csv('https://datasets.holoviz.org/penguins/v1/penguins.csv')\n",
+ "\n",
+ "pn.extension('tabulator', inline=False)"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "c97d1504-89d6-4c74-9ce7-7f755d6d94f4",
+ "metadata": {},
+ "source": [
+ "## Introducing Panel Material UI: A Modern Makeover for Panel Apps\n",
+ "\n",
+ "We have been building [Panel](https://panel.holoviz.org) for almost 7 years now. Today, it powers dashboards, AI workflows, and data applications across research and industry, with over **1.2 million downloads per month**. At the same time one piece of feedback we've gotten over and over was that it was **too hard to style Panel components**. So we set out to build a **comprehensive, consistent, and API compatible set of components**, replacing the existing Panel implementations.\n",
+ "\n",
+ "Today we’re excited to introduce **[`panel-material-ui`](https://panel-material-ui.holoviz.org)**, a new extension that wraps the [Material UI](https://mui.com/) React components in Panel. It gives you a modern, cohesive design system out of the box — while staying fully compatible with your existing Panel code.\n",
+ "\n",
+ "Try it out today with:\n",
+ "\n",
+ "```bash\n",
+ "pip install panel-material-ui\n",
+ "```\n",
+ "\n",
+ "or:\n",
+ "\n",
+ "```bash\n",
+ "conda install conda-forge::panel-material-ui\n",
+ "```"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 2,
+ "id": "9ea5fa41-51f0-4d72-be43-24ff3c1a138d",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/html": [
+ "\n",
+ " \n",
+ " "
+ ],
+ "text/plain": [
+ ""
+ ]
+ },
+ "execution_count": 2,
+ "metadata": {},
+ "output_type": "execute_result"
+ }
+ ],
+ "source": [
+ "#| echo: false\n",
+ "from IPython.display import IFrame\n",
+ "\n",
+ "IFrame('https://panel-material-ui.holoviz.org/_static/demo.html', width=\"100%\", height=\"420px\")"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "e31cace8-1d83-496a-b375-64bfbce5f364",
+ "metadata": {},
+ "source": [
+ "## Why?\n",
+ "\n",
+ "Panel’s built-in components were added incrementally over time, usually without involving UI/UX experts, leading to inconsistent styles and theming that’s tricky to apply. Customizing the look and feel often meant CSS overrides and one-off workarounds. To remedy the situation we wanted to make sure we maintained compatibility with existing Panel components while exposing as many MUI components as possible.\n",
+ "\n",
+ "Why [MUI]((https://mui.com/)) in particular, you might ask? We wanted to build on a library that has:\n",
+ "\n",
+ "* **Maturity**: MUI is one of the most widely used React component libraries, with strong community support and robust documentation.\n",
+ "* **Consistent Design**: It implements Google’s Material Design system, providing a polished and consistent user experience out of the box.\n",
+ "* **Customizable and themeable**: MUI has a well-designed theming system that maps cleanly to how we wanted to style Panel apps.\n",
+ "* **Strong accessibility support**: MUI handles many of the hard parts of accessibility for us, giving us a more solid foundation.\n",
+ "* **Component breadth**: It includes a wide range of components — from simple buttons to complex layout and navigation elements — that we can gradually wrap and expose in Panel.\n",
+ "\n",
+ "But for our (and your) sanity we also wanted a library that would make it easy to create new components. The tight React implementation just made it a joy to build, particularly with AI assistance. This also means creating custom components building on `panel-material-ui` is a breeze."
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "721fcbb6-587e-4db1-94c4-24923cbcebc7",
+ "metadata": {},
+ "source": [
+ "## How?\n",
+ "\n",
+ "With the addition of [ESM components](https://panel.holoviz.org/how_to/custom_components/index.html#esm-components), that allow you to communicate seamlessly between the Python based Panel object and the model that is rendered on the frontend, it has finally become straightforward to build custom Panel components. Building on the [React integration](https://panel.holoviz.org/reference/custom_components/ReactComponent.html) I quickly discovered that since mapping parameters in Python to React state was such a simple problem, LLMs would go a long way. Using a simple prompt, I was able to bootstrap a comprehensive set of components and their respective React implementations. That said, I have always been skeptical of fully auto-generated component wrappers. While nice in theory, the UX of a fully automated wrapper library will always suffer, and the initial AI generated component-set I had generated was no different.\n",
+ "\n",
+ "Once the basic structure was in place, we went to work and reviewed, cleaned up and documented each component in detail. At this point I'd like to extend special thanks to [Thuy Do](https://github.com/thuydotm) and [Marc Skov Madsen](https://github.com/MarcSkovMadsen) for their efforts in writing tests, documentation and generally providing feedback."
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "2e4eb67e-35d6-4873-8771-fb93af2dadaf",
+ "metadata": {},
+ "source": [
+ "## What can it do?\n",
+ "\n",
+ "Okay, so what can it actually do? Yes, we've added 70+ components, and they're all consistently styled, but what else is possible now that wasn't before?"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "04e4782f-81f2-46a2-9aa5-25f96e6adf12",
+ "metadata": {},
+ "source": [
+ "### Compatibility\n",
+ "\n",
+ "Above, we mentioned that `panel-material-ui` has full compatibility with Panel, but what does that actually mean? The goal from the very beginning was to provide a set of components that could be drop-in replacements for existing Panel components, this means that you should be able to change the imports and with a few minor exceptions the `panel-material-ui` component should behave just like the original Panel one. The idea being that the transition to panel-material-ui should be as easy as possible and that when we eventually replace the original Panel components as part of the Panel 2.0 release, there will not be a major transition either. Compatibility also means you can mix-and-match regular `panel` and `panel-material-ui` components as you see fit."
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "f7358c0c-f3d1-4957-8450-42298639b364",
+ "metadata": {},
+ "source": [
+ "### Theming & Styling\n",
+ "\n",
+ "In the past Panel had introduced a so called `Design`. We build on that here but for the most part only use that system to ensure that the theme defined in `panel-material-ui` flows down to standard Panel components. Let's briefly define our technology:\n",
+ "\n",
+ "- **Design**: The overall set of CSS stylesheets, component defaults that align an application with a particular design system.\n",
+ "- **Theme**: A theme in Panel defines the configuration of default color settings in both light (default) and dark mode.\n",
+ "- **Styling**: Applying one-off modications to a specific components.\n",
+ "\n",
+ "In `panel-material-ui` the main entrypoint for theming that you need to care about is the [`theme_config` parameter](https://panel-material-ui.holoviz.org/customization/customize.html#theming), present on all Material components. It makes it easy to configure the default colors, typography and more, either globally or differentially for dark and light themes. Thanks to inheritance the `theme_config` can be applied on a parent component and will flow down to all its children:"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 3,
+ "id": "880d7bec-22ea-4a77-ad51-63938b3206e3",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {},
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/vnd.holoviews_exec.v0+json": "",
+ "text/html": [
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "Card(_names=['', ''], design=\n",
+ " \n",
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "FloatSlider(design=\n",
+ " \n",
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "HTML(str, design=\n",
+ " \n",
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "Column(design=\n",
+ " \n",
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "HTML(str, design=