diff --git a/posts/panel_material_ui_announcement/images/panel-material-ui-branding.png b/posts/panel_material_ui_announcement/images/panel-material-ui-branding.png
new file mode 100644
index 0000000..fed5e6e
Binary files /dev/null and b/posts/panel_material_ui_announcement/images/panel-material-ui-branding.png differ
diff --git a/posts/panel_material_ui_announcement/images/panel-material-ui-components.png b/posts/panel_material_ui_announcement/images/panel-material-ui-components.png
new file mode 100644
index 0000000..55ea872
Binary files /dev/null and b/posts/panel_material_ui_announcement/images/panel-material-ui-components.png differ
diff --git a/posts/panel_material_ui_announcement/images/panel-material-ui-custom-dashboard.png b/posts/panel_material_ui_announcement/images/panel-material-ui-custom-dashboard.png
new file mode 100644
index 0000000..1992bb6
Binary files /dev/null and b/posts/panel_material_ui_announcement/images/panel-material-ui-custom-dashboard.png differ
diff --git a/posts/panel_material_ui_announcement/index.ipynb b/posts/panel_material_ui_announcement/index.ipynb
new file mode 100644
index 0000000..8cb65e0
--- /dev/null
+++ b/posts/panel_material_ui_announcement/index.ipynb
@@ -0,0 +1,2094 @@
+{
+ "cells": [
+ {
+ "cell_type": "markdown",
+ "id": "10c11462-c5af-4c84-af69-8bb9b8e86924",
+ "metadata": {},
+ "source": [
+ "---\n",
+ "title: \"Panel Material UI Announcement\"\n",
+ "date: \"2025-05-13\"\n",
+ "description: \"Announcing the release of panel-material-ui, a new extension that wraps Material UI components in Panel.\"\n",
+ "author: \"Philipp Rudiger\"\n",
+ "categories: [announcement, panel]\n",
+ "image: \"images/panel-material-ui-components.png\"\n",
+ "---"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 2,
+ "id": "975a7ce3-27ee-48a1-846f-f7e0ca8f1ccd",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/html": [
+ ""
+ ]
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "(function(root) {\n",
+ " function now() {\n",
+ " return new Date();\n",
+ " }\n",
+ "\n",
+ " const force = true;\n",
+ " const py_version = '3.7.3rc2'.replace('rc', '-rc.').replace('.dev', '-dev.');\n",
+ " const reloading = false;\n",
+ " const Bokeh = root.Bokeh;\n",
+ "\n",
+ " // Set a timeout for this load but only if we are not already initializing\n",
+ " if (typeof (root._bokeh_timeout) === \"undefined\" || (force || !root._bokeh_is_initializing)) {\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_failed_load = false;\n",
+ " }\n",
+ "\n",
+ " function run_callbacks() {\n",
+ " try {\n",
+ " root._bokeh_onload_callbacks.forEach(function(callback) {\n",
+ " if (callback != null)\n",
+ " callback();\n",
+ " });\n",
+ " } finally {\n",
+ " delete root._bokeh_onload_callbacks;\n",
+ " }\n",
+ " console.debug(\"Bokeh: all callbacks have finished\");\n",
+ " }\n",
+ "\n",
+ " function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n",
+ " if (css_urls == null) css_urls = [];\n",
+ " if (js_urls == null) js_urls = [];\n",
+ " if (js_modules == null) js_modules = [];\n",
+ " if (js_exports == null) js_exports = {};\n",
+ "\n",
+ " root._bokeh_onload_callbacks.push(callback);\n",
+ "\n",
+ " if (root._bokeh_is_loading > 0) {\n",
+ " // Don't load bokeh if it is still initializing\n",
+ " console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n",
+ " return null;\n",
+ " } else if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n",
+ " // There is nothing to load\n",
+ " run_callbacks();\n",
+ " return null;\n",
+ " }\n",
+ "\n",
+ " function on_load() {\n",
+ " root._bokeh_is_loading--;\n",
+ " if (root._bokeh_is_loading === 0) {\n",
+ " console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n",
+ " run_callbacks()\n",
+ " }\n",
+ " }\n",
+ " window._bokeh_on_load = on_load\n",
+ "\n",
+ " function on_error(e) {\n",
+ " const src_el = e.srcElement\n",
+ " console.error(\"failed to load \" + (src_el.href || src_el.src));\n",
+ " }\n",
+ "\n",
+ " const skip = [];\n",
+ " if (window.requirejs) {\n",
+ " window.requirejs.config({'packages': {}, 'paths': {}, 'shim': {}});\n",
+ " root._bokeh_is_loading = css_urls.length + 0;\n",
+ " } else {\n",
+ " root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n",
+ " }\n",
+ "\n",
+ " const existing_stylesheets = []\n",
+ " const links = document.getElementsByTagName('link')\n",
+ " for (let i = 0; i < links.length; i++) {\n",
+ " const link = links[i]\n",
+ " if (link.href != null) {\n",
+ " existing_stylesheets.push(link.href)\n",
+ " }\n",
+ " }\n",
+ " for (let i = 0; i < css_urls.length; i++) {\n",
+ " const url = css_urls[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (existing_stylesheets.indexOf(escaped) !== -1) {\n",
+ " on_load()\n",
+ " continue;\n",
+ " }\n",
+ " const element = document.createElement(\"link\");\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.rel = \"stylesheet\";\n",
+ " element.type = \"text/css\";\n",
+ " element.href = url;\n",
+ " console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n",
+ " document.body.appendChild(element);\n",
+ " } var existing_scripts = []\n",
+ " const scripts = document.getElementsByTagName('script')\n",
+ " for (let i = 0; i < scripts.length; i++) {\n",
+ " var script = scripts[i]\n",
+ " if (script.src != null) {\n",
+ " existing_scripts.push(script.src)\n",
+ " }\n",
+ " }\n",
+ " for (let i = 0; i < js_urls.length; i++) {\n",
+ " const url = js_urls[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " const element = document.createElement('script');\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.src = url;\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " for (let i = 0; i < js_modules.length; i++) {\n",
+ " const url = js_modules[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " var element = document.createElement('script');\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.src = url;\n",
+ " element.type = \"module\";\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " for (const name in js_exports) {\n",
+ " const url = js_exports[name];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) >= 0 || root[name] != null) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " var element = document.createElement('script');\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.type = \"module\";\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " element.textContent = `\n",
+ " import ${name} from \"${url}\"\n",
+ " window.${name} = ${name}\n",
+ " window._bokeh_on_load()\n",
+ " `\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " if (!js_urls.length && !js_modules.length) {\n",
+ " on_load()\n",
+ " }\n",
+ " };\n",
+ "\n",
+ " function inject_raw_css(css) {\n",
+ " const element = document.createElement(\"style\");\n",
+ " element.appendChild(document.createTextNode(css));\n",
+ " document.body.appendChild(element);\n",
+ " }\n",
+ "\n",
+ " const js_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/reactiveesm/es-module-shims@^1.10.0/dist/es-module-shims.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-gl-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-widgets-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-tables-3.7.3rc2.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/panel.min.js\"];\n",
+ " const js_modules = [];\n",
+ " const js_exports = {};\n",
+ " const css_urls = [\"https://cdn.holoviz.org/panel-material-ui/v0.1.1/panel-material-ui.bundle.css?v=1.7.0\"];\n",
+ " const inline_js = [ function(Bokeh) {\n",
+ " Bokeh.set_log_level(\"info\");\n",
+ " },\n",
+ "function(Bokeh) {} // ensure no trailing comma for IE\n",
+ " ];\n",
+ "\n",
+ " function run_inline_js() {\n",
+ " if ((root.Bokeh !== undefined) || (force === true)) {\n",
+ " for (let i = 0; i < inline_js.length; i++) {\n",
+ " try {\n",
+ " inline_js[i].call(root, root.Bokeh);\n",
+ " } catch(e) {\n",
+ " if (!reloading) {\n",
+ " throw e;\n",
+ " }\n",
+ " }\n",
+ " }\n",
+ " // Cache old bokeh versions\n",
+ " if (Bokeh != undefined && !reloading) {\n",
+ " var NewBokeh = root.Bokeh;\n",
+ " if (Bokeh.versions === undefined) {\n",
+ " Bokeh.versions = new Map();\n",
+ " }\n",
+ " if (NewBokeh.version !== Bokeh.version) {\n",
+ " Bokeh.versions.set(NewBokeh.version, NewBokeh)\n",
+ " }\n",
+ " root.Bokeh = Bokeh;\n",
+ " }\n",
+ " } else if (Date.now() < root._bokeh_timeout) {\n",
+ " setTimeout(run_inline_js, 100);\n",
+ " } else if (!root._bokeh_failed_load) {\n",
+ " console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n",
+ " root._bokeh_failed_load = true;\n",
+ " }\n",
+ " root._bokeh_is_initializing = false\n",
+ " }\n",
+ "\n",
+ " function load_or_wait() {\n",
+ " // Implement a backoff loop that tries to ensure we do not load multiple\n",
+ " // versions of Bokeh and its dependencies at the same time.\n",
+ " // In recent versions we use the root._bokeh_is_initializing flag\n",
+ " // to determine whether there is an ongoing attempt to initialize\n",
+ " // bokeh, however for backward compatibility we also try to ensure\n",
+ " // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n",
+ " // before older versions are fully initialized.\n",
+ " if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n",
+ " // If the timeout and bokeh was not successfully loaded we reset\n",
+ " // everything and try loading again\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_is_initializing = false;\n",
+ " root._bokeh_onload_callbacks = undefined;\n",
+ " root._bokeh_is_loading = 0\n",
+ " console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n",
+ " load_or_wait();\n",
+ " } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n",
+ " setTimeout(load_or_wait, 100);\n",
+ " } else {\n",
+ " root._bokeh_is_initializing = true\n",
+ " root._bokeh_onload_callbacks = []\n",
+ " const bokeh_loaded = root.Bokeh != null && (root.Bokeh.version === py_version || (root.Bokeh.versions !== undefined && root.Bokeh.versions.has(py_version)));\n",
+ " if (!reloading && !bokeh_loaded) {\n",
+ " if (root.Bokeh) {\n",
+ " root.Bokeh = undefined;\n",
+ " }\n",
+ " console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n",
+ " }\n",
+ " load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n",
+ " console.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n",
+ " run_inline_js();\n",
+ " });\n",
+ " }\n",
+ " }\n",
+ " // Give older versions of the autoload script a head-start to ensure\n",
+ " // they initialize before we start loading newer version.\n",
+ " setTimeout(load_or_wait, 100)\n",
+ "}(window));"
+ ],
+ "application/vnd.holoviews_load.v0+json": "(function(root) {\n function now() {\n return new Date();\n }\n\n const force = true;\n const py_version = '3.7.3rc2'.replace('rc', '-rc.').replace('.dev', '-dev.');\n const reloading = false;\n const Bokeh = root.Bokeh;\n\n // Set a timeout for this load but only if we are not already initializing\n if (typeof (root._bokeh_timeout) === \"undefined\" || (force || !root._bokeh_is_initializing)) {\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_failed_load = false;\n }\n\n function run_callbacks() {\n try {\n root._bokeh_onload_callbacks.forEach(function(callback) {\n if (callback != null)\n callback();\n });\n } finally {\n delete root._bokeh_onload_callbacks;\n }\n console.debug(\"Bokeh: all callbacks have finished\");\n }\n\n function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n if (css_urls == null) css_urls = [];\n if (js_urls == null) js_urls = [];\n if (js_modules == null) js_modules = [];\n if (js_exports == null) js_exports = {};\n\n root._bokeh_onload_callbacks.push(callback);\n\n if (root._bokeh_is_loading > 0) {\n // Don't load bokeh if it is still initializing\n console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n return null;\n } else if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n // There is nothing to load\n run_callbacks();\n return null;\n }\n\n function on_load() {\n root._bokeh_is_loading--;\n if (root._bokeh_is_loading === 0) {\n console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n run_callbacks()\n }\n }\n window._bokeh_on_load = on_load\n\n function on_error(e) {\n const src_el = e.srcElement\n console.error(\"failed to load \" + (src_el.href || src_el.src));\n }\n\n const skip = [];\n if (window.requirejs) {\n window.requirejs.config({'packages': {}, 'paths': {}, 'shim': {}});\n root._bokeh_is_loading = css_urls.length + 0;\n } else {\n root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n }\n\n const existing_stylesheets = []\n const links = document.getElementsByTagName('link')\n for (let i = 0; i < links.length; i++) {\n const link = links[i]\n if (link.href != null) {\n existing_stylesheets.push(link.href)\n }\n }\n for (let i = 0; i < css_urls.length; i++) {\n const url = css_urls[i];\n const escaped = encodeURI(url)\n if (existing_stylesheets.indexOf(escaped) !== -1) {\n on_load()\n continue;\n }\n const element = document.createElement(\"link\");\n element.onload = on_load;\n element.onerror = on_error;\n element.rel = \"stylesheet\";\n element.type = \"text/css\";\n element.href = url;\n console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n document.body.appendChild(element);\n } var existing_scripts = []\n const scripts = document.getElementsByTagName('script')\n for (let i = 0; i < scripts.length; i++) {\n var script = scripts[i]\n if (script.src != null) {\n existing_scripts.push(script.src)\n }\n }\n for (let i = 0; i < js_urls.length; i++) {\n const url = js_urls[i];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n const element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (let i = 0; i < js_modules.length; i++) {\n const url = js_modules[i];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n var element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (const name in js_exports) {\n const url = js_exports[name];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) >= 0 || root[name] != null) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n var element = document.createElement('script');\n element.onerror = on_error;\n element.async = false;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n element.textContent = `\n import ${name} from \"${url}\"\n window.${name} = ${name}\n window._bokeh_on_load()\n `\n document.head.appendChild(element);\n }\n if (!js_urls.length && !js_modules.length) {\n on_load()\n }\n };\n\n function inject_raw_css(css) {\n const element = document.createElement(\"style\");\n element.appendChild(document.createTextNode(css));\n document.body.appendChild(element);\n }\n\n const js_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/reactiveesm/es-module-shims@^1.10.0/dist/es-module-shims.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-gl-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-widgets-3.7.3rc2.min.js\", \"https://cdn.bokeh.org/bokeh/dev/bokeh-tables-3.7.3rc2.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/panel.min.js\"];\n const js_modules = [];\n const js_exports = {};\n const css_urls = [\"https://cdn.holoviz.org/panel-material-ui/v0.1.1/panel-material-ui.bundle.css?v=1.7.0\"];\n const inline_js = [ function(Bokeh) {\n Bokeh.set_log_level(\"info\");\n },\nfunction(Bokeh) {} // ensure no trailing comma for IE\n ];\n\n function run_inline_js() {\n if ((root.Bokeh !== undefined) || (force === true)) {\n for (let i = 0; i < inline_js.length; i++) {\n try {\n inline_js[i].call(root, root.Bokeh);\n } catch(e) {\n if (!reloading) {\n throw e;\n }\n }\n }\n // Cache old bokeh versions\n if (Bokeh != undefined && !reloading) {\n var NewBokeh = root.Bokeh;\n if (Bokeh.versions === undefined) {\n Bokeh.versions = new Map();\n }\n if (NewBokeh.version !== Bokeh.version) {\n Bokeh.versions.set(NewBokeh.version, NewBokeh)\n }\n root.Bokeh = Bokeh;\n }\n } else if (Date.now() < root._bokeh_timeout) {\n setTimeout(run_inline_js, 100);\n } else if (!root._bokeh_failed_load) {\n console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n root._bokeh_failed_load = true;\n }\n root._bokeh_is_initializing = false\n }\n\n function load_or_wait() {\n // Implement a backoff loop that tries to ensure we do not load multiple\n // versions of Bokeh and its dependencies at the same time.\n // In recent versions we use the root._bokeh_is_initializing flag\n // to determine whether there is an ongoing attempt to initialize\n // bokeh, however for backward compatibility we also try to ensure\n // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n // before older versions are fully initialized.\n if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n // If the timeout and bokeh was not successfully loaded we reset\n // everything and try loading again\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_is_initializing = false;\n root._bokeh_onload_callbacks = undefined;\n root._bokeh_is_loading = 0\n console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n load_or_wait();\n } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n setTimeout(load_or_wait, 100);\n } else {\n root._bokeh_is_initializing = true\n root._bokeh_onload_callbacks = []\n const bokeh_loaded = root.Bokeh != null && (root.Bokeh.version === py_version || (root.Bokeh.versions !== undefined && root.Bokeh.versions.has(py_version)));\n if (!reloading && !bokeh_loaded) {\n if (root.Bokeh) {\n root.Bokeh = undefined;\n }\n console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n }\n load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n console.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n run_inline_js();\n });\n }\n }\n // Give older versions of the autoload script a head-start to ensure\n // they initialize before we start loading newer version.\n setTimeout(load_or_wait, 100)\n}(window));"
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "\n",
+ "if ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n",
+ " window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n",
+ "}\n",
+ "\n",
+ "\n",
+ " function JupyterCommManager() {\n",
+ " }\n",
+ "\n",
+ " JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n",
+ " if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n",
+ " var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n",
+ " comm_manager.register_target(comm_id, function(comm) {\n",
+ " comm.on_msg(msg_handler);\n",
+ " });\n",
+ " } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n",
+ " window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n",
+ " comm.onMsg = msg_handler;\n",
+ " });\n",
+ " } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n",
+ " google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n",
+ " var messages = comm.messages[Symbol.asyncIterator]();\n",
+ " function processIteratorResult(result) {\n",
+ " var message = result.value;\n",
+ " console.log(message)\n",
+ " var content = {data: message.data, comm_id};\n",
+ " var buffers = []\n",
+ " for (var buffer of message.buffers || []) {\n",
+ " buffers.push(new DataView(buffer))\n",
+ " }\n",
+ " var metadata = message.metadata || {};\n",
+ " var msg = {content, buffers, metadata}\n",
+ " msg_handler(msg);\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " })\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n",
+ " if (comm_id in window.PyViz.comms) {\n",
+ " return window.PyViz.comms[comm_id];\n",
+ " } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n",
+ " var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n",
+ " var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n",
+ " if (msg_handler) {\n",
+ " comm.on_msg(msg_handler);\n",
+ " }\n",
+ " } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n",
+ " var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n",
+ " comm.open();\n",
+ " if (msg_handler) {\n",
+ " comm.onMsg = msg_handler;\n",
+ " }\n",
+ " } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n",
+ " var comm_promise = google.colab.kernel.comms.open(comm_id)\n",
+ " comm_promise.then((comm) => {\n",
+ " window.PyViz.comms[comm_id] = comm;\n",
+ " if (msg_handler) {\n",
+ " var messages = comm.messages[Symbol.asyncIterator]();\n",
+ " function processIteratorResult(result) {\n",
+ " var message = result.value;\n",
+ " var content = {data: message.data};\n",
+ " var metadata = message.metadata || {comm_id};\n",
+ " var msg = {content, metadata}\n",
+ " msg_handler(msg);\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " })\n",
+ " var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n",
+ " return comm_promise.then((comm) => {\n",
+ " comm.send(data, metadata, buffers, disposeOnDone);\n",
+ " });\n",
+ " };\n",
+ " var comm = {\n",
+ " send: sendClosure\n",
+ " };\n",
+ " }\n",
+ " window.PyViz.comms[comm_id] = comm;\n",
+ " return comm;\n",
+ " }\n",
+ " window.PyViz.comm_manager = new JupyterCommManager();\n",
+ " \n",
+ "\n",
+ "\n",
+ "var JS_MIME_TYPE = 'application/javascript';\n",
+ "var HTML_MIME_TYPE = 'text/html';\n",
+ "var EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\n",
+ "var CLASS_NAME = 'output';\n",
+ "\n",
+ "/**\n",
+ " * Render data to the DOM node\n",
+ " */\n",
+ "function render(props, node) {\n",
+ " var div = document.createElement(\"div\");\n",
+ " var script = document.createElement(\"script\");\n",
+ " node.appendChild(div);\n",
+ " node.appendChild(script);\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle when a new output is added\n",
+ " */\n",
+ "function handle_add_output(event, handle) {\n",
+ " var output_area = handle.output_area;\n",
+ " var output = handle.output;\n",
+ " if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n",
+ " return\n",
+ " }\n",
+ " var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n",
+ " var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n",
+ " if (id !== undefined) {\n",
+ " var nchildren = toinsert.length;\n",
+ " var html_node = toinsert[nchildren-1].children[0];\n",
+ " html_node.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " var scripts = [];\n",
+ " var nodelist = html_node.querySelectorAll(\"script\");\n",
+ " for (var i in nodelist) {\n",
+ " if (nodelist.hasOwnProperty(i)) {\n",
+ " scripts.push(nodelist[i])\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " scripts.forEach( function (oldScript) {\n",
+ " var newScript = document.createElement(\"script\");\n",
+ " var attrs = [];\n",
+ " var nodemap = oldScript.attributes;\n",
+ " for (var j in nodemap) {\n",
+ " if (nodemap.hasOwnProperty(j)) {\n",
+ " attrs.push(nodemap[j])\n",
+ " }\n",
+ " }\n",
+ " attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n",
+ " newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n",
+ " oldScript.parentNode.replaceChild(newScript, oldScript);\n",
+ " });\n",
+ " if (JS_MIME_TYPE in output.data) {\n",
+ " toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n",
+ " }\n",
+ " output_area._hv_plot_id = id;\n",
+ " if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n",
+ " window.PyViz.plot_index[id] = Bokeh.index[id];\n",
+ " } else {\n",
+ " window.PyViz.plot_index[id] = null;\n",
+ " }\n",
+ " } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n",
+ " var bk_div = document.createElement(\"div\");\n",
+ " bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " var script_attrs = bk_div.children[0].attributes;\n",
+ " for (var i = 0; i < script_attrs.length; i++) {\n",
+ " toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n",
+ " }\n",
+ " // store reference to server id on output_area\n",
+ " output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n",
+ " }\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle when an output is cleared or removed\n",
+ " */\n",
+ "function handle_clear_output(event, handle) {\n",
+ " var id = handle.cell.output_area._hv_plot_id;\n",
+ " var server_id = handle.cell.output_area._bokeh_server_id;\n",
+ " if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n",
+ " var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n",
+ " if (server_id !== null) {\n",
+ " comm.send({event_type: 'server_delete', 'id': server_id});\n",
+ " return;\n",
+ " } else if (comm !== null) {\n",
+ " comm.send({event_type: 'delete', 'id': id});\n",
+ " }\n",
+ " delete PyViz.plot_index[id];\n",
+ " if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n",
+ " var doc = window.Bokeh.index[id].model.document\n",
+ " doc.clear();\n",
+ " const i = window.Bokeh.documents.indexOf(doc);\n",
+ " if (i > -1) {\n",
+ " window.Bokeh.documents.splice(i, 1);\n",
+ " }\n",
+ " }\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle kernel restart event\n",
+ " */\n",
+ "function handle_kernel_cleanup(event, handle) {\n",
+ " delete PyViz.comms[\"hv-extension-comm\"];\n",
+ " window.PyViz.plot_index = {}\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle update_display_data messages\n",
+ " */\n",
+ "function handle_update_output(event, handle) {\n",
+ " handle_clear_output(event, {cell: {output_area: handle.output_area}})\n",
+ " handle_add_output(event, handle)\n",
+ "}\n",
+ "\n",
+ "function register_renderer(events, OutputArea) {\n",
+ " function append_mime(data, metadata, element) {\n",
+ " // create a DOM node to render to\n",
+ " var toinsert = this.create_output_subarea(\n",
+ " metadata,\n",
+ " CLASS_NAME,\n",
+ " EXEC_MIME_TYPE\n",
+ " );\n",
+ " this.keyboard_manager.register_events(toinsert);\n",
+ " // Render to node\n",
+ " var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n",
+ " render(props, toinsert[0]);\n",
+ " element.append(toinsert);\n",
+ " return toinsert\n",
+ " }\n",
+ "\n",
+ " events.on('output_added.OutputArea', handle_add_output);\n",
+ " events.on('output_updated.OutputArea', handle_update_output);\n",
+ " events.on('clear_output.CodeCell', handle_clear_output);\n",
+ " events.on('delete.Cell', handle_clear_output);\n",
+ " events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n",
+ "\n",
+ " OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n",
+ " safe: true,\n",
+ " index: 0\n",
+ " });\n",
+ "}\n",
+ "\n",
+ "if (window.Jupyter !== undefined) {\n",
+ " try {\n",
+ " var events = require('base/js/events');\n",
+ " var OutputArea = require('notebook/js/outputarea').OutputArea;\n",
+ " if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n",
+ " register_renderer(events, OutputArea);\n",
+ " }\n",
+ " } catch(err) {\n",
+ " }\n",
+ "}\n"
+ ],
+ "application/vnd.holoviews_load.v0+json": "\nif ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n}\n\n\n function JupyterCommManager() {\n }\n\n JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n comm_manager.register_target(comm_id, function(comm) {\n comm.on_msg(msg_handler);\n });\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n comm.onMsg = msg_handler;\n });\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n console.log(message)\n var content = {data: message.data, comm_id};\n var buffers = []\n for (var buffer of message.buffers || []) {\n buffers.push(new DataView(buffer))\n }\n var metadata = message.metadata || {};\n var msg = {content, buffers, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n })\n }\n }\n\n JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n if (comm_id in window.PyViz.comms) {\n return window.PyViz.comms[comm_id];\n } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n if (msg_handler) {\n comm.on_msg(msg_handler);\n }\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n comm.open();\n if (msg_handler) {\n comm.onMsg = msg_handler;\n }\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n var comm_promise = google.colab.kernel.comms.open(comm_id)\n comm_promise.then((comm) => {\n window.PyViz.comms[comm_id] = comm;\n if (msg_handler) {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n var content = {data: message.data};\n var metadata = message.metadata || {comm_id};\n var msg = {content, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n }\n })\n var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n return comm_promise.then((comm) => {\n comm.send(data, metadata, buffers, disposeOnDone);\n });\n };\n var comm = {\n send: sendClosure\n };\n }\n window.PyViz.comms[comm_id] = comm;\n return comm;\n }\n window.PyViz.comm_manager = new JupyterCommManager();\n \n\n\nvar JS_MIME_TYPE = 'application/javascript';\nvar HTML_MIME_TYPE = 'text/html';\nvar EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\nvar CLASS_NAME = 'output';\n\n/**\n * Render data to the DOM node\n */\nfunction render(props, node) {\n var div = document.createElement(\"div\");\n var script = document.createElement(\"script\");\n node.appendChild(div);\n node.appendChild(script);\n}\n\n/**\n * Handle when a new output is added\n */\nfunction handle_add_output(event, handle) {\n var output_area = handle.output_area;\n var output = handle.output;\n if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n return\n }\n var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n if (id !== undefined) {\n var nchildren = toinsert.length;\n var html_node = toinsert[nchildren-1].children[0];\n html_node.innerHTML = output.data[HTML_MIME_TYPE];\n var scripts = [];\n var nodelist = html_node.querySelectorAll(\"script\");\n for (var i in nodelist) {\n if (nodelist.hasOwnProperty(i)) {\n scripts.push(nodelist[i])\n }\n }\n\n scripts.forEach( function (oldScript) {\n var newScript = document.createElement(\"script\");\n var attrs = [];\n var nodemap = oldScript.attributes;\n for (var j in nodemap) {\n if (nodemap.hasOwnProperty(j)) {\n attrs.push(nodemap[j])\n }\n }\n attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n oldScript.parentNode.replaceChild(newScript, oldScript);\n });\n if (JS_MIME_TYPE in output.data) {\n toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n }\n output_area._hv_plot_id = id;\n if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n window.PyViz.plot_index[id] = Bokeh.index[id];\n } else {\n window.PyViz.plot_index[id] = null;\n }\n } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n var bk_div = document.createElement(\"div\");\n bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n var script_attrs = bk_div.children[0].attributes;\n for (var i = 0; i < script_attrs.length; i++) {\n toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n }\n // store reference to server id on output_area\n output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n }\n}\n\n/**\n * Handle when an output is cleared or removed\n */\nfunction handle_clear_output(event, handle) {\n var id = handle.cell.output_area._hv_plot_id;\n var server_id = handle.cell.output_area._bokeh_server_id;\n if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n if (server_id !== null) {\n comm.send({event_type: 'server_delete', 'id': server_id});\n return;\n } else if (comm !== null) {\n comm.send({event_type: 'delete', 'id': id});\n }\n delete PyViz.plot_index[id];\n if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n var doc = window.Bokeh.index[id].model.document\n doc.clear();\n const i = window.Bokeh.documents.indexOf(doc);\n if (i > -1) {\n window.Bokeh.documents.splice(i, 1);\n }\n }\n}\n\n/**\n * Handle kernel restart event\n */\nfunction handle_kernel_cleanup(event, handle) {\n delete PyViz.comms[\"hv-extension-comm\"];\n window.PyViz.plot_index = {}\n}\n\n/**\n * Handle update_display_data messages\n */\nfunction handle_update_output(event, handle) {\n handle_clear_output(event, {cell: {output_area: handle.output_area}})\n handle_add_output(event, handle)\n}\n\nfunction register_renderer(events, OutputArea) {\n function append_mime(data, metadata, element) {\n // create a DOM node to render to\n var toinsert = this.create_output_subarea(\n metadata,\n CLASS_NAME,\n EXEC_MIME_TYPE\n );\n this.keyboard_manager.register_events(toinsert);\n // Render to node\n var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n render(props, toinsert[0]);\n element.append(toinsert);\n return toinsert\n }\n\n events.on('output_added.OutputArea', handle_add_output);\n events.on('output_updated.OutputArea', handle_update_output);\n events.on('clear_output.CodeCell', handle_clear_output);\n events.on('delete.Cell', handle_clear_output);\n events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n\n OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n safe: true,\n index: 0\n });\n}\n\nif (window.Jupyter !== undefined) {\n try {\n var events = require('base/js/events');\n var OutputArea = require('notebook/js/outputarea').OutputArea;\n if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n register_renderer(events, OutputArea);\n }\n } catch(err) {\n }\n}\n"
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/vnd.holoviews_exec.v0+json": "",
+ "text/html": [
+ "
\n",
+ ""
+ ]
+ },
+ "metadata": {
+ "application/vnd.holoviews_exec.v0+json": {
+ "id": "fcfd2cce-a7d6-4b32-86ad-a32d43582c28"
+ }
+ },
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "text/html": [
+ ""
+ ]
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "(function(root) {\n",
+ " function now() {\n",
+ " return new Date();\n",
+ " }\n",
+ "\n",
+ " const force = false;\n",
+ " const py_version = '3.7.3rc2'.replace('rc', '-rc.').replace('.dev', '-dev.');\n",
+ " const reloading = true;\n",
+ " const Bokeh = root.Bokeh;\n",
+ "\n",
+ " // Set a timeout for this load but only if we are not already initializing\n",
+ " if (typeof (root._bokeh_timeout) === \"undefined\" || (force || !root._bokeh_is_initializing)) {\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_failed_load = false;\n",
+ " }\n",
+ "\n",
+ " function run_callbacks() {\n",
+ " try {\n",
+ " root._bokeh_onload_callbacks.forEach(function(callback) {\n",
+ " if (callback != null)\n",
+ " callback();\n",
+ " });\n",
+ " } finally {\n",
+ " delete root._bokeh_onload_callbacks;\n",
+ " }\n",
+ " console.debug(\"Bokeh: all callbacks have finished\");\n",
+ " }\n",
+ "\n",
+ " function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n",
+ " if (css_urls == null) css_urls = [];\n",
+ " if (js_urls == null) js_urls = [];\n",
+ " if (js_modules == null) js_modules = [];\n",
+ " if (js_exports == null) js_exports = {};\n",
+ "\n",
+ " root._bokeh_onload_callbacks.push(callback);\n",
+ "\n",
+ " if (root._bokeh_is_loading > 0) {\n",
+ " // Don't load bokeh if it is still initializing\n",
+ " console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n",
+ " return null;\n",
+ " } else if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n",
+ " // There is nothing to load\n",
+ " run_callbacks();\n",
+ " return null;\n",
+ " }\n",
+ "\n",
+ " function on_load() {\n",
+ " root._bokeh_is_loading--;\n",
+ " if (root._bokeh_is_loading === 0) {\n",
+ " console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n",
+ " run_callbacks()\n",
+ " }\n",
+ " }\n",
+ " window._bokeh_on_load = on_load\n",
+ "\n",
+ " function on_error(e) {\n",
+ " const src_el = e.srcElement\n",
+ " console.error(\"failed to load \" + (src_el.href || src_el.src));\n",
+ " }\n",
+ "\n",
+ " const skip = [];\n",
+ " if (window.requirejs) {\n",
+ " window.requirejs.config({'packages': {}, 'paths': {'tabulator': 'https://cdn.jsdelivr.net/npm/tabulator-tables@6.3.1/dist/js/tabulator.min', 'moment': 'https://cdn.jsdelivr.net/npm/luxon/build/global/luxon.min'}, 'shim': {}});\n",
+ " require([\"tabulator\"], function(Tabulator) {\n",
+ " window.Tabulator = Tabulator\n",
+ " on_load()\n",
+ " })\n",
+ " require([\"moment\"], function(moment) {\n",
+ " window.moment = moment\n",
+ " on_load()\n",
+ " })\n",
+ " root._bokeh_is_loading = css_urls.length + 2;\n",
+ " } else {\n",
+ " root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n",
+ " }\n",
+ "\n",
+ " const existing_stylesheets = []\n",
+ " const links = document.getElementsByTagName('link')\n",
+ " for (let i = 0; i < links.length; i++) {\n",
+ " const link = links[i]\n",
+ " if (link.href != null) {\n",
+ " existing_stylesheets.push(link.href)\n",
+ " }\n",
+ " }\n",
+ " for (let i = 0; i < css_urls.length; i++) {\n",
+ " const url = css_urls[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (existing_stylesheets.indexOf(escaped) !== -1) {\n",
+ " on_load()\n",
+ " continue;\n",
+ " }\n",
+ " const element = document.createElement(\"link\");\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.rel = \"stylesheet\";\n",
+ " element.type = \"text/css\";\n",
+ " element.href = url;\n",
+ " console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n",
+ " document.body.appendChild(element);\n",
+ " } if (((window.Tabulator !== undefined) && (!(window.Tabulator instanceof HTMLElement))) || window.requirejs) {\n",
+ " var urls = ['https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/js/tabulator.min.js'];\n",
+ " for (var i = 0; i < urls.length; i++) {\n",
+ " skip.push(encodeURI(urls[i]))\n",
+ " }\n",
+ " } if (((window.moment !== undefined) && (!(window.moment instanceof HTMLElement))) || window.requirejs) {\n",
+ " var urls = ['https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/luxon/build/global/luxon.min.js'];\n",
+ " for (var i = 0; i < urls.length; i++) {\n",
+ " skip.push(encodeURI(urls[i]))\n",
+ " }\n",
+ " } var existing_scripts = []\n",
+ " const scripts = document.getElementsByTagName('script')\n",
+ " for (let i = 0; i < scripts.length; i++) {\n",
+ " var script = scripts[i]\n",
+ " if (script.src != null) {\n",
+ " existing_scripts.push(script.src)\n",
+ " }\n",
+ " }\n",
+ " for (let i = 0; i < js_urls.length; i++) {\n",
+ " const url = js_urls[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " const element = document.createElement('script');\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.src = url;\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " for (let i = 0; i < js_modules.length; i++) {\n",
+ " const url = js_modules[i];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " var element = document.createElement('script');\n",
+ " element.onload = on_load;\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.src = url;\n",
+ " element.type = \"module\";\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " for (const name in js_exports) {\n",
+ " const url = js_exports[name];\n",
+ " const escaped = encodeURI(url)\n",
+ " if (skip.indexOf(escaped) >= 0 || root[name] != null) {\n",
+ " if (!window.requirejs) {\n",
+ " on_load();\n",
+ " }\n",
+ " continue;\n",
+ " }\n",
+ " var element = document.createElement('script');\n",
+ " element.onerror = on_error;\n",
+ " element.async = false;\n",
+ " element.type = \"module\";\n",
+ " console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n",
+ " element.textContent = `\n",
+ " import ${name} from \"${url}\"\n",
+ " window.${name} = ${name}\n",
+ " window._bokeh_on_load()\n",
+ " `\n",
+ " document.head.appendChild(element);\n",
+ " }\n",
+ " if (!js_urls.length && !js_modules.length) {\n",
+ " on_load()\n",
+ " }\n",
+ " };\n",
+ "\n",
+ " function inject_raw_css(css) {\n",
+ " const element = document.createElement(\"style\");\n",
+ " element.appendChild(document.createTextNode(css));\n",
+ " document.body.appendChild(element);\n",
+ " }\n",
+ "\n",
+ " const js_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/reactiveesm/es-module-shims@^1.10.0/dist/es-module-shims.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/js/tabulator.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/luxon/build/global/luxon.min.js\"];\n",
+ " const js_modules = [];\n",
+ " const js_exports = {};\n",
+ " const css_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/css/tabulator_simple.min.css?v=1.7.0\", \"https://cdn.holoviz.org/panel-material-ui/v0.1.1/panel-material-ui.bundle.css?v=1.7.0\"];\n",
+ " const inline_js = [ function(Bokeh) {\n",
+ " Bokeh.set_log_level(\"info\");\n",
+ " },\n",
+ "function(Bokeh) {} // ensure no trailing comma for IE\n",
+ " ];\n",
+ "\n",
+ " function run_inline_js() {\n",
+ " if ((root.Bokeh !== undefined) || (force === true)) {\n",
+ " for (let i = 0; i < inline_js.length; i++) {\n",
+ " try {\n",
+ " inline_js[i].call(root, root.Bokeh);\n",
+ " } catch(e) {\n",
+ " if (!reloading) {\n",
+ " throw e;\n",
+ " }\n",
+ " }\n",
+ " }\n",
+ " // Cache old bokeh versions\n",
+ " if (Bokeh != undefined && !reloading) {\n",
+ " var NewBokeh = root.Bokeh;\n",
+ " if (Bokeh.versions === undefined) {\n",
+ " Bokeh.versions = new Map();\n",
+ " }\n",
+ " if (NewBokeh.version !== Bokeh.version) {\n",
+ " Bokeh.versions.set(NewBokeh.version, NewBokeh)\n",
+ " }\n",
+ " root.Bokeh = Bokeh;\n",
+ " }\n",
+ " } else if (Date.now() < root._bokeh_timeout) {\n",
+ " setTimeout(run_inline_js, 100);\n",
+ " } else if (!root._bokeh_failed_load) {\n",
+ " console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n",
+ " root._bokeh_failed_load = true;\n",
+ " }\n",
+ " root._bokeh_is_initializing = false\n",
+ " }\n",
+ "\n",
+ " function load_or_wait() {\n",
+ " // Implement a backoff loop that tries to ensure we do not load multiple\n",
+ " // versions of Bokeh and its dependencies at the same time.\n",
+ " // In recent versions we use the root._bokeh_is_initializing flag\n",
+ " // to determine whether there is an ongoing attempt to initialize\n",
+ " // bokeh, however for backward compatibility we also try to ensure\n",
+ " // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n",
+ " // before older versions are fully initialized.\n",
+ " if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n",
+ " // If the timeout and bokeh was not successfully loaded we reset\n",
+ " // everything and try loading again\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_is_initializing = false;\n",
+ " root._bokeh_onload_callbacks = undefined;\n",
+ " root._bokeh_is_loading = 0\n",
+ " console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n",
+ " load_or_wait();\n",
+ " } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n",
+ " setTimeout(load_or_wait, 100);\n",
+ " } else {\n",
+ " root._bokeh_is_initializing = true\n",
+ " root._bokeh_onload_callbacks = []\n",
+ " const bokeh_loaded = root.Bokeh != null && (root.Bokeh.version === py_version || (root.Bokeh.versions !== undefined && root.Bokeh.versions.has(py_version)));\n",
+ " if (!reloading && !bokeh_loaded) {\n",
+ " if (root.Bokeh) {\n",
+ " root.Bokeh = undefined;\n",
+ " }\n",
+ " console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n",
+ " }\n",
+ " load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n",
+ " console.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n",
+ " run_inline_js();\n",
+ " });\n",
+ " }\n",
+ " }\n",
+ " // Give older versions of the autoload script a head-start to ensure\n",
+ " // they initialize before we start loading newer version.\n",
+ " setTimeout(load_or_wait, 100)\n",
+ "}(window));"
+ ],
+ "application/vnd.holoviews_load.v0+json": "(function(root) {\n function now() {\n return new Date();\n }\n\n const force = false;\n const py_version = '3.7.3rc2'.replace('rc', '-rc.').replace('.dev', '-dev.');\n const reloading = true;\n const Bokeh = root.Bokeh;\n\n // Set a timeout for this load but only if we are not already initializing\n if (typeof (root._bokeh_timeout) === \"undefined\" || (force || !root._bokeh_is_initializing)) {\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_failed_load = false;\n }\n\n function run_callbacks() {\n try {\n root._bokeh_onload_callbacks.forEach(function(callback) {\n if (callback != null)\n callback();\n });\n } finally {\n delete root._bokeh_onload_callbacks;\n }\n console.debug(\"Bokeh: all callbacks have finished\");\n }\n\n function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n if (css_urls == null) css_urls = [];\n if (js_urls == null) js_urls = [];\n if (js_modules == null) js_modules = [];\n if (js_exports == null) js_exports = {};\n\n root._bokeh_onload_callbacks.push(callback);\n\n if (root._bokeh_is_loading > 0) {\n // Don't load bokeh if it is still initializing\n console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n return null;\n } else if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n // There is nothing to load\n run_callbacks();\n return null;\n }\n\n function on_load() {\n root._bokeh_is_loading--;\n if (root._bokeh_is_loading === 0) {\n console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n run_callbacks()\n }\n }\n window._bokeh_on_load = on_load\n\n function on_error(e) {\n const src_el = e.srcElement\n console.error(\"failed to load \" + (src_el.href || src_el.src));\n }\n\n const skip = [];\n if (window.requirejs) {\n window.requirejs.config({'packages': {}, 'paths': {'tabulator': 'https://cdn.jsdelivr.net/npm/tabulator-tables@6.3.1/dist/js/tabulator.min', 'moment': 'https://cdn.jsdelivr.net/npm/luxon/build/global/luxon.min'}, 'shim': {}});\n require([\"tabulator\"], function(Tabulator) {\n window.Tabulator = Tabulator\n on_load()\n })\n require([\"moment\"], function(moment) {\n window.moment = moment\n on_load()\n })\n root._bokeh_is_loading = css_urls.length + 2;\n } else {\n root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n }\n\n const existing_stylesheets = []\n const links = document.getElementsByTagName('link')\n for (let i = 0; i < links.length; i++) {\n const link = links[i]\n if (link.href != null) {\n existing_stylesheets.push(link.href)\n }\n }\n for (let i = 0; i < css_urls.length; i++) {\n const url = css_urls[i];\n const escaped = encodeURI(url)\n if (existing_stylesheets.indexOf(escaped) !== -1) {\n on_load()\n continue;\n }\n const element = document.createElement(\"link\");\n element.onload = on_load;\n element.onerror = on_error;\n element.rel = \"stylesheet\";\n element.type = \"text/css\";\n element.href = url;\n console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n document.body.appendChild(element);\n } if (((window.Tabulator !== undefined) && (!(window.Tabulator instanceof HTMLElement))) || window.requirejs) {\n var urls = ['https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/js/tabulator.min.js'];\n for (var i = 0; i < urls.length; i++) {\n skip.push(encodeURI(urls[i]))\n }\n } if (((window.moment !== undefined) && (!(window.moment instanceof HTMLElement))) || window.requirejs) {\n var urls = ['https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/luxon/build/global/luxon.min.js'];\n for (var i = 0; i < urls.length; i++) {\n skip.push(encodeURI(urls[i]))\n }\n } var existing_scripts = []\n const scripts = document.getElementsByTagName('script')\n for (let i = 0; i < scripts.length; i++) {\n var script = scripts[i]\n if (script.src != null) {\n existing_scripts.push(script.src)\n }\n }\n for (let i = 0; i < js_urls.length; i++) {\n const url = js_urls[i];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n const element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (let i = 0; i < js_modules.length; i++) {\n const url = js_modules[i];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) !== -1 || existing_scripts.indexOf(escaped) !== -1) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n var element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (const name in js_exports) {\n const url = js_exports[name];\n const escaped = encodeURI(url)\n if (skip.indexOf(escaped) >= 0 || root[name] != null) {\n if (!window.requirejs) {\n on_load();\n }\n continue;\n }\n var element = document.createElement('script');\n element.onerror = on_error;\n element.async = false;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n element.textContent = `\n import ${name} from \"${url}\"\n window.${name} = ${name}\n window._bokeh_on_load()\n `\n document.head.appendChild(element);\n }\n if (!js_urls.length && !js_modules.length) {\n on_load()\n }\n };\n\n function inject_raw_css(css) {\n const element = document.createElement(\"style\");\n element.appendChild(document.createTextNode(css));\n document.body.appendChild(element);\n }\n\n const js_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/reactiveesm/es-module-shims@^1.10.0/dist/es-module-shims.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/js/tabulator.min.js\", \"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/luxon/build/global/luxon.min.js\"];\n const js_modules = [];\n const js_exports = {};\n const css_urls = [\"https://cdn.holoviz.org/panel/1.7.0/dist/bundled/datatabulator/tabulator-tables@6.3.1/dist/css/tabulator_simple.min.css?v=1.7.0\", \"https://cdn.holoviz.org/panel-material-ui/v0.1.1/panel-material-ui.bundle.css?v=1.7.0\"];\n const inline_js = [ function(Bokeh) {\n Bokeh.set_log_level(\"info\");\n },\nfunction(Bokeh) {} // ensure no trailing comma for IE\n ];\n\n function run_inline_js() {\n if ((root.Bokeh !== undefined) || (force === true)) {\n for (let i = 0; i < inline_js.length; i++) {\n try {\n inline_js[i].call(root, root.Bokeh);\n } catch(e) {\n if (!reloading) {\n throw e;\n }\n }\n }\n // Cache old bokeh versions\n if (Bokeh != undefined && !reloading) {\n var NewBokeh = root.Bokeh;\n if (Bokeh.versions === undefined) {\n Bokeh.versions = new Map();\n }\n if (NewBokeh.version !== Bokeh.version) {\n Bokeh.versions.set(NewBokeh.version, NewBokeh)\n }\n root.Bokeh = Bokeh;\n }\n } else if (Date.now() < root._bokeh_timeout) {\n setTimeout(run_inline_js, 100);\n } else if (!root._bokeh_failed_load) {\n console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n root._bokeh_failed_load = true;\n }\n root._bokeh_is_initializing = false\n }\n\n function load_or_wait() {\n // Implement a backoff loop that tries to ensure we do not load multiple\n // versions of Bokeh and its dependencies at the same time.\n // In recent versions we use the root._bokeh_is_initializing flag\n // to determine whether there is an ongoing attempt to initialize\n // bokeh, however for backward compatibility we also try to ensure\n // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n // before older versions are fully initialized.\n if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n // If the timeout and bokeh was not successfully loaded we reset\n // everything and try loading again\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_is_initializing = false;\n root._bokeh_onload_callbacks = undefined;\n root._bokeh_is_loading = 0\n console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n load_or_wait();\n } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n setTimeout(load_or_wait, 100);\n } else {\n root._bokeh_is_initializing = true\n root._bokeh_onload_callbacks = []\n const bokeh_loaded = root.Bokeh != null && (root.Bokeh.version === py_version || (root.Bokeh.versions !== undefined && root.Bokeh.versions.has(py_version)));\n if (!reloading && !bokeh_loaded) {\n if (root.Bokeh) {\n root.Bokeh = undefined;\n }\n console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n }\n load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n console.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n run_inline_js();\n });\n }\n }\n // Give older versions of the autoload script a head-start to ensure\n // they initialize before we start loading newer version.\n setTimeout(load_or_wait, 100)\n}(window));"
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "\n",
+ "if ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n",
+ " window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n",
+ "}\n",
+ "\n",
+ "\n",
+ " function JupyterCommManager() {\n",
+ " }\n",
+ "\n",
+ " JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n",
+ " if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n",
+ " var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n",
+ " comm_manager.register_target(comm_id, function(comm) {\n",
+ " comm.on_msg(msg_handler);\n",
+ " });\n",
+ " } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n",
+ " window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n",
+ " comm.onMsg = msg_handler;\n",
+ " });\n",
+ " } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n",
+ " google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n",
+ " var messages = comm.messages[Symbol.asyncIterator]();\n",
+ " function processIteratorResult(result) {\n",
+ " var message = result.value;\n",
+ " console.log(message)\n",
+ " var content = {data: message.data, comm_id};\n",
+ " var buffers = []\n",
+ " for (var buffer of message.buffers || []) {\n",
+ " buffers.push(new DataView(buffer))\n",
+ " }\n",
+ " var metadata = message.metadata || {};\n",
+ " var msg = {content, buffers, metadata}\n",
+ " msg_handler(msg);\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " })\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n",
+ " if (comm_id in window.PyViz.comms) {\n",
+ " return window.PyViz.comms[comm_id];\n",
+ " } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n",
+ " var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n",
+ " var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n",
+ " if (msg_handler) {\n",
+ " comm.on_msg(msg_handler);\n",
+ " }\n",
+ " } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n",
+ " var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n",
+ " comm.open();\n",
+ " if (msg_handler) {\n",
+ " comm.onMsg = msg_handler;\n",
+ " }\n",
+ " } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n",
+ " var comm_promise = google.colab.kernel.comms.open(comm_id)\n",
+ " comm_promise.then((comm) => {\n",
+ " window.PyViz.comms[comm_id] = comm;\n",
+ " if (msg_handler) {\n",
+ " var messages = comm.messages[Symbol.asyncIterator]();\n",
+ " function processIteratorResult(result) {\n",
+ " var message = result.value;\n",
+ " var content = {data: message.data};\n",
+ " var metadata = message.metadata || {comm_id};\n",
+ " var msg = {content, metadata}\n",
+ " msg_handler(msg);\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " return messages.next().then(processIteratorResult);\n",
+ " }\n",
+ " })\n",
+ " var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n",
+ " return comm_promise.then((comm) => {\n",
+ " comm.send(data, metadata, buffers, disposeOnDone);\n",
+ " });\n",
+ " };\n",
+ " var comm = {\n",
+ " send: sendClosure\n",
+ " };\n",
+ " }\n",
+ " window.PyViz.comms[comm_id] = comm;\n",
+ " return comm;\n",
+ " }\n",
+ " window.PyViz.comm_manager = new JupyterCommManager();\n",
+ " \n",
+ "\n",
+ "\n",
+ "var JS_MIME_TYPE = 'application/javascript';\n",
+ "var HTML_MIME_TYPE = 'text/html';\n",
+ "var EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\n",
+ "var CLASS_NAME = 'output';\n",
+ "\n",
+ "/**\n",
+ " * Render data to the DOM node\n",
+ " */\n",
+ "function render(props, node) {\n",
+ " var div = document.createElement(\"div\");\n",
+ " var script = document.createElement(\"script\");\n",
+ " node.appendChild(div);\n",
+ " node.appendChild(script);\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle when a new output is added\n",
+ " */\n",
+ "function handle_add_output(event, handle) {\n",
+ " var output_area = handle.output_area;\n",
+ " var output = handle.output;\n",
+ " if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n",
+ " return\n",
+ " }\n",
+ " var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n",
+ " var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n",
+ " if (id !== undefined) {\n",
+ " var nchildren = toinsert.length;\n",
+ " var html_node = toinsert[nchildren-1].children[0];\n",
+ " html_node.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " var scripts = [];\n",
+ " var nodelist = html_node.querySelectorAll(\"script\");\n",
+ " for (var i in nodelist) {\n",
+ " if (nodelist.hasOwnProperty(i)) {\n",
+ " scripts.push(nodelist[i])\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " scripts.forEach( function (oldScript) {\n",
+ " var newScript = document.createElement(\"script\");\n",
+ " var attrs = [];\n",
+ " var nodemap = oldScript.attributes;\n",
+ " for (var j in nodemap) {\n",
+ " if (nodemap.hasOwnProperty(j)) {\n",
+ " attrs.push(nodemap[j])\n",
+ " }\n",
+ " }\n",
+ " attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n",
+ " newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n",
+ " oldScript.parentNode.replaceChild(newScript, oldScript);\n",
+ " });\n",
+ " if (JS_MIME_TYPE in output.data) {\n",
+ " toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n",
+ " }\n",
+ " output_area._hv_plot_id = id;\n",
+ " if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n",
+ " window.PyViz.plot_index[id] = Bokeh.index[id];\n",
+ " } else {\n",
+ " window.PyViz.plot_index[id] = null;\n",
+ " }\n",
+ " } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n",
+ " var bk_div = document.createElement(\"div\");\n",
+ " bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " var script_attrs = bk_div.children[0].attributes;\n",
+ " for (var i = 0; i < script_attrs.length; i++) {\n",
+ " toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n",
+ " }\n",
+ " // store reference to server id on output_area\n",
+ " output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n",
+ " }\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle when an output is cleared or removed\n",
+ " */\n",
+ "function handle_clear_output(event, handle) {\n",
+ " var id = handle.cell.output_area._hv_plot_id;\n",
+ " var server_id = handle.cell.output_area._bokeh_server_id;\n",
+ " if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n",
+ " var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n",
+ " if (server_id !== null) {\n",
+ " comm.send({event_type: 'server_delete', 'id': server_id});\n",
+ " return;\n",
+ " } else if (comm !== null) {\n",
+ " comm.send({event_type: 'delete', 'id': id});\n",
+ " }\n",
+ " delete PyViz.plot_index[id];\n",
+ " if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n",
+ " var doc = window.Bokeh.index[id].model.document\n",
+ " doc.clear();\n",
+ " const i = window.Bokeh.documents.indexOf(doc);\n",
+ " if (i > -1) {\n",
+ " window.Bokeh.documents.splice(i, 1);\n",
+ " }\n",
+ " }\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle kernel restart event\n",
+ " */\n",
+ "function handle_kernel_cleanup(event, handle) {\n",
+ " delete PyViz.comms[\"hv-extension-comm\"];\n",
+ " window.PyViz.plot_index = {}\n",
+ "}\n",
+ "\n",
+ "/**\n",
+ " * Handle update_display_data messages\n",
+ " */\n",
+ "function handle_update_output(event, handle) {\n",
+ " handle_clear_output(event, {cell: {output_area: handle.output_area}})\n",
+ " handle_add_output(event, handle)\n",
+ "}\n",
+ "\n",
+ "function register_renderer(events, OutputArea) {\n",
+ " function append_mime(data, metadata, element) {\n",
+ " // create a DOM node to render to\n",
+ " var toinsert = this.create_output_subarea(\n",
+ " metadata,\n",
+ " CLASS_NAME,\n",
+ " EXEC_MIME_TYPE\n",
+ " );\n",
+ " this.keyboard_manager.register_events(toinsert);\n",
+ " // Render to node\n",
+ " var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n",
+ " render(props, toinsert[0]);\n",
+ " element.append(toinsert);\n",
+ " return toinsert\n",
+ " }\n",
+ "\n",
+ " events.on('output_added.OutputArea', handle_add_output);\n",
+ " events.on('output_updated.OutputArea', handle_update_output);\n",
+ " events.on('clear_output.CodeCell', handle_clear_output);\n",
+ " events.on('delete.Cell', handle_clear_output);\n",
+ " events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n",
+ "\n",
+ " OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n",
+ " safe: true,\n",
+ " index: 0\n",
+ " });\n",
+ "}\n",
+ "\n",
+ "if (window.Jupyter !== undefined) {\n",
+ " try {\n",
+ " var events = require('base/js/events');\n",
+ " var OutputArea = require('notebook/js/outputarea').OutputArea;\n",
+ " if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n",
+ " register_renderer(events, OutputArea);\n",
+ " }\n",
+ " } catch(err) {\n",
+ " }\n",
+ "}\n"
+ ],
+ "application/vnd.holoviews_load.v0+json": "\nif ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n}\n\n\n function JupyterCommManager() {\n }\n\n JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n comm_manager.register_target(comm_id, function(comm) {\n comm.on_msg(msg_handler);\n });\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n comm.onMsg = msg_handler;\n });\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n console.log(message)\n var content = {data: message.data, comm_id};\n var buffers = []\n for (var buffer of message.buffers || []) {\n buffers.push(new DataView(buffer))\n }\n var metadata = message.metadata || {};\n var msg = {content, buffers, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n })\n }\n }\n\n JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n if (comm_id in window.PyViz.comms) {\n return window.PyViz.comms[comm_id];\n } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n if (msg_handler) {\n comm.on_msg(msg_handler);\n }\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n comm.open();\n if (msg_handler) {\n comm.onMsg = msg_handler;\n }\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n var comm_promise = google.colab.kernel.comms.open(comm_id)\n comm_promise.then((comm) => {\n window.PyViz.comms[comm_id] = comm;\n if (msg_handler) {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n var content = {data: message.data};\n var metadata = message.metadata || {comm_id};\n var msg = {content, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n }\n })\n var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n return comm_promise.then((comm) => {\n comm.send(data, metadata, buffers, disposeOnDone);\n });\n };\n var comm = {\n send: sendClosure\n };\n }\n window.PyViz.comms[comm_id] = comm;\n return comm;\n }\n window.PyViz.comm_manager = new JupyterCommManager();\n \n\n\nvar JS_MIME_TYPE = 'application/javascript';\nvar HTML_MIME_TYPE = 'text/html';\nvar EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\nvar CLASS_NAME = 'output';\n\n/**\n * Render data to the DOM node\n */\nfunction render(props, node) {\n var div = document.createElement(\"div\");\n var script = document.createElement(\"script\");\n node.appendChild(div);\n node.appendChild(script);\n}\n\n/**\n * Handle when a new output is added\n */\nfunction handle_add_output(event, handle) {\n var output_area = handle.output_area;\n var output = handle.output;\n if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n return\n }\n var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n if (id !== undefined) {\n var nchildren = toinsert.length;\n var html_node = toinsert[nchildren-1].children[0];\n html_node.innerHTML = output.data[HTML_MIME_TYPE];\n var scripts = [];\n var nodelist = html_node.querySelectorAll(\"script\");\n for (var i in nodelist) {\n if (nodelist.hasOwnProperty(i)) {\n scripts.push(nodelist[i])\n }\n }\n\n scripts.forEach( function (oldScript) {\n var newScript = document.createElement(\"script\");\n var attrs = [];\n var nodemap = oldScript.attributes;\n for (var j in nodemap) {\n if (nodemap.hasOwnProperty(j)) {\n attrs.push(nodemap[j])\n }\n }\n attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n oldScript.parentNode.replaceChild(newScript, oldScript);\n });\n if (JS_MIME_TYPE in output.data) {\n toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n }\n output_area._hv_plot_id = id;\n if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n window.PyViz.plot_index[id] = Bokeh.index[id];\n } else {\n window.PyViz.plot_index[id] = null;\n }\n } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n var bk_div = document.createElement(\"div\");\n bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n var script_attrs = bk_div.children[0].attributes;\n for (var i = 0; i < script_attrs.length; i++) {\n toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n }\n // store reference to server id on output_area\n output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n }\n}\n\n/**\n * Handle when an output is cleared or removed\n */\nfunction handle_clear_output(event, handle) {\n var id = handle.cell.output_area._hv_plot_id;\n var server_id = handle.cell.output_area._bokeh_server_id;\n if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n if (server_id !== null) {\n comm.send({event_type: 'server_delete', 'id': server_id});\n return;\n } else if (comm !== null) {\n comm.send({event_type: 'delete', 'id': id});\n }\n delete PyViz.plot_index[id];\n if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n var doc = window.Bokeh.index[id].model.document\n doc.clear();\n const i = window.Bokeh.documents.indexOf(doc);\n if (i > -1) {\n window.Bokeh.documents.splice(i, 1);\n }\n }\n}\n\n/**\n * Handle kernel restart event\n */\nfunction handle_kernel_cleanup(event, handle) {\n delete PyViz.comms[\"hv-extension-comm\"];\n window.PyViz.plot_index = {}\n}\n\n/**\n * Handle update_display_data messages\n */\nfunction handle_update_output(event, handle) {\n handle_clear_output(event, {cell: {output_area: handle.output_area}})\n handle_add_output(event, handle)\n}\n\nfunction register_renderer(events, OutputArea) {\n function append_mime(data, metadata, element) {\n // create a DOM node to render to\n var toinsert = this.create_output_subarea(\n metadata,\n CLASS_NAME,\n EXEC_MIME_TYPE\n );\n this.keyboard_manager.register_events(toinsert);\n // Render to node\n var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n render(props, toinsert[0]);\n element.append(toinsert);\n return toinsert\n }\n\n events.on('output_added.OutputArea', handle_add_output);\n events.on('output_updated.OutputArea', handle_update_output);\n events.on('clear_output.CodeCell', handle_clear_output);\n events.on('delete.Cell', handle_clear_output);\n events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n\n OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n safe: true,\n index: 0\n });\n}\n\nif (window.Jupyter !== undefined) {\n try {\n var events = require('base/js/events');\n var OutputArea = require('notebook/js/outputarea').OutputArea;\n if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n register_renderer(events, OutputArea);\n }\n } catch(err) {\n }\n}\n"
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ }
+ ],
+ "source": [
+ "#| echo: false\n",
+ "import hvplot.pandas\n",
+ "import panel as pn\n",
+ "import pandas as pd\n",
+ "import panel_material_ui as pmui\n",
+ "\n",
+ "df = pd.read_csv('https://datasets.holoviz.org/penguins/v1/penguins.csv')\n",
+ "\n",
+ "pn.extension('tabulator', inline=False)"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "36fbb256",
+ "metadata": {},
+ "source": [
+ "Today we’re very excited to introduce **[`panel-material-ui`](https://panel-material-ui.holoviz.org)**, a Panel extension that provides **a set of modern components and a cohesive design system** built upon [Material UI](https://mui.com/). It is fully compatible with your existing Panel code.\n",
+ "\n",
+ "We will start using it in production now, which means you can expect this extension to mature rapidly. Our goal is to replace the existing Panel components with `panel-material-ui` components in a Panel 2.0 release."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 3,
+ "id": "a3c1be56",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/html": [
+ "\n",
+ " \n",
+ " "
+ ],
+ "text/plain": [
+ ""
+ ]
+ },
+ "execution_count": 3,
+ "metadata": {},
+ "output_type": "execute_result"
+ }
+ ],
+ "source": [
+ "#| echo: false\n",
+ "from IPython.display import IFrame\n",
+ "\n",
+ "IFrame('https://panel-material-ui.holoviz.org/_static/demo.html', width=\"100%\", height=\"800px\")"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "c97d1504-89d6-4c74-9ce7-7f755d6d94f4",
+ "metadata": {},
+ "source": [
+ "Try it out today with:\n",
+ "\n",
+ "```bash\n",
+ "pip install panel-material-ui\n",
+ "```\n",
+ "\n",
+ "or:\n",
+ "\n",
+ "```bash\n",
+ "conda install conda-forge::panel-material-ui\n",
+ "```"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "e31cace8-1d83-496a-b375-64bfbce5f364",
+ "metadata": {},
+ "source": [
+ "## Why?\n",
+ "\n",
+ "We have been building [Panel](https://panel.holoviz.org) for almost 7 years now. Today, it powers dashboards, AI workflows, and data applications across research and industry, with over **1.2 million downloads per month**. At the same time one piece of feedback we've gotten over and over was that it was **too hard to style Panel components**.\n",
+ "\n",
+ "So we set out to build a **comprehensive, consistent, and API compatible set of components**, replacing the existing Panel implementations. We wanted to make sure we maintained compatibility with existing Panel components while exposing as many MUI components as possible.\n",
+ "\n",
+ "Why [MUI]((https://mui.com/)) in particular, you might ask? We wanted to build on a library that has:\n",
+ "\n",
+ "* **Maturity**: MUI is one of the most widely used React component libraries, with strong community support and robust documentation.\n",
+ "* **Consistent Design**: It implements Google’s Material Design system, providing a polished and consistent user experience out of the box.\n",
+ "* **Customizable and themeable**: MUI has a well-designed theming system that maps cleanly to how we wanted to style Panel apps.\n",
+ "* **Strong accessibility support**: MUI handles many of the hard parts of accessibility for us, giving us a more solid foundation.\n",
+ "* **Component breadth**: It includes a wide range of components — from simple buttons to complex layout and navigation elements — that we can gradually wrap and expose in Panel.\n",
+ "\n",
+ "But for our (and your) sanity we also wanted a library that would make it **easy to create new components**. The tight React implementation just made it a joy to build, particularly with AI assistance. This also means creating custom components building on `panel-material-ui` is a breeze."
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "721fcbb6-587e-4db1-94c4-24923cbcebc7",
+ "metadata": {},
+ "source": [
+ "## How?\n",
+ "\n",
+ "With the addition of [ESM components](https://panel.holoviz.org/how_to/custom_components/index.html#esm-components), it has finally become straightforward to build custom Panel components. Building on the [React integration](https://panel.holoviz.org/reference/custom_components/ReactComponent.html), I quickly discovered that mapping parameters in Python to React state was a simple problem where LLMs could provide significant assistance. Using a simple prompt, I was able to bootstrap a comprehensive set of components and their respective React implementations. That said, I've always been skeptical of fully auto-generated component wrappers. While promising in theory, the UX of a purely automated wrapper library inevitably suffers, and the initial AI-generated component set was no exception.\n",
+ "\n",
+ "Once the basic structure was in place, we methodically reviewed, cleaned up, and documented each component in detail. At this point, I'd like to extend special thanks to [Thuy Do](https://github.com/thuydotm) and [Marc Skov Madsen](https://github.com/MarcSkovMadsen) for their invaluable contributions in writing tests, creating documentation, and providing feedback throughout the process."
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "2e4eb67e-35d6-4873-8771-fb93af2dadaf",
+ "metadata": {},
+ "source": [
+ "## What can it do?\n",
+ "\n",
+ "Okay, so what can it actually do? Yes, we've added 70+ components, and they're all consistently styled, but what else is possible now that wasn't before?"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "f7358c0c-f3d1-4957-8450-42298639b364",
+ "metadata": {},
+ "source": [
+ "### Theming & Styling\n",
+ "\n",
+ "In the past Panel had introduced a so called `Design`. We build on that here but for the most part only use that system to ensure that the theme defined in `panel-material-ui` flows down to standard Panel components. Let's briefly define our technology:\n",
+ "\n",
+ "- **Design**: The overall set of CSS stylesheets, component defaults that align an application with a particular design system.\n",
+ "- **Theme**: A theme in Panel defines the configuration of default color settings in both light (default) and dark mode.\n",
+ "- **Styling**: Applying one-off modications to a specific components.\n",
+ "\n",
+ "In `panel-material-ui` the main entrypoint for theming that you need to care about is the [`theme_config` parameter](https://panel-material-ui.holoviz.org/customization/customize.html#theming), present on all Material components. It makes it easy to configure the default colors, typography and more, either globally or differentially for dark and light themes. Thanks to inheritance the `theme_config` can be applied on a parent component and will flow down to all its children:"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 4,
+ "id": "880d7bec-22ea-4a77-ad51-63938b3206e3",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {},
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/vnd.holoviews_exec.v0+json": "",
+ "text/html": [
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "Card(_names=['', ''], design=\n",
+ " \n",
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "FloatSlider(design=\n",
+ "\n",
+ "Here is another example of a highly customized dashboard:\n",
+ "\n",
+ "
"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "30787358-5620-4bff-bdfe-123f985dbd49",
+ "metadata": {},
+ "source": [
+ "### Dark Mode\n",
+ "\n",
+ "In Panel theming happened on the backend, i.e. if you toggled between the default (light) and the dark theme the application would have to re-run in order to ensure the updated theming would be propagated. In `panel-material-ui` theming happens client-side. By using the `ThemeToggle` or [`Page`](https://panel-material-ui.holoviz.org/reference/page/Page.html) components in your app you enter managed theming mode where the theme is controlled globally and styles are updated dynamically."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 6,
+ "id": "0900c782-9182-4cfb-905e-e9e5fd0b914f",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {},
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/vnd.holoviews_exec.v0+json": "",
+ "text/html": [
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "HTML(str, design=\n",
+ " \n",
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "Column(design=\n",
+ " \n",
+ "\n",
+ ""
+ ],
+ "text/plain": [
+ "HTML(str, design=